Ryujinx/src/Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs

1704 lines
54 KiB
C#
Raw Normal View History

[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
using Avalonia;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
using Avalonia.Controls;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
using Avalonia.Controls.ApplicationLifetimes;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
using Avalonia.Input;
using Avalonia.Media;
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
using Avalonia.Platform.Storage;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
using Avalonia.Threading;
using DynamicData;
using DynamicData.Binding;
using LibHac.Common;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
using Ryujinx.Ava.Common;
using Ryujinx.Ava.Common.Locale;
UI - Avalonia Part 2 (#3351) * add settings windows and children views * Expose hotkeys configuration on the UI * Remove double spacing from locale JSON * simplify button assigner * add cemuhook buttons and title to locale * move common button assigner to own class * cancel button assigner when window is closed * remove unused setting * address review. fix controller profile not loading default when switching devices * fix updater file name * Input cleanup (#37) * addressed review * add device type to controller device checks * change accessibility modifier of public classes to internal * Update Ryujinx.Ava/Ui/ViewModels/ControllerSettingsViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update de_DE.json * Update de_DE.json * Update tr_TR.json Translated newly added lines * Update it_IT.json * fix rebase * update avalonia * fix wrong key used for button text * Align settings window elements * Tabs to spaces * Update brazilian portuguese translation * Minor improvement on brazilian portuguese translation * fix turkish translation * remove unused text * change view related classes to public * unsubscribe from deferred event if dialog is closed * Load the default language before loading any other when switching languages * Make controller settings more compact * increase default width of settings window, reduce profile buttons width Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com>
2022-07-05 18:06:31 +00:00
using Ryujinx.Ava.Input;
Ava GUI: Restructure `Ryujinx.Ava` (#4165) * Restructure `Ryujinx.Ava` * Stylistic consistency * Update Ryujinx.Ava/UI/Controls/UserEditor.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/UserEditor.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/UserSelector.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/SaveManager.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/SaveManager.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Windows/SettingsWindow.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Windows/SettingsWindow.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/ViewModels/UserProfileViewModel.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/ViewModels/UserProfileViewModel.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Fix redundancies * Remove redunancies * Add back elses Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com>
2022-12-29 14:24:05 +00:00
using Ryujinx.Ava.UI.Controls;
using Ryujinx.Ava.UI.Helpers;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
using Ryujinx.Ava.UI.Models;
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
using Ryujinx.Ava.UI.Models.Generic;
using Ryujinx.Ava.UI.Renderer;
Ava GUI: Restructure `Ryujinx.Ava` (#4165) * Restructure `Ryujinx.Ava` * Stylistic consistency * Update Ryujinx.Ava/UI/Controls/UserEditor.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/UserEditor.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/UserSelector.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/SaveManager.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/SaveManager.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Windows/SettingsWindow.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Windows/SettingsWindow.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/ViewModels/UserProfileViewModel.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/ViewModels/UserProfileViewModel.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Fix redundancies * Remove redunancies * Add back elses Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com>
2022-12-29 14:24:05 +00:00
using Ryujinx.Ava.UI.Windows;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
using Ryujinx.Common;
using Ryujinx.Common.Configuration;
using Ryujinx.Common.Logging;
using Ryujinx.Cpu;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
using Ryujinx.HLE;
using Ryujinx.HLE.FileSystem;
using Ryujinx.HLE.HOS;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
using Ryujinx.HLE.HOS.Services.Account.Acc;
using Ryujinx.HLE.Ui;
using Ryujinx.Input.HLE;
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
using Ryujinx.Modules;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
using Ryujinx.Ui.App.Common;
using Ryujinx.Ui.Common;
using Ryujinx.Ui.Common.Configuration;
using Ryujinx.Ui.Common.Helper;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
using SixLabors.ImageSharp.PixelFormats;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
using System;
using System.Collections.Generic;
using System.Collections.ObjectModel;
using System.IO;
using System.Threading;
using System.Threading.Tasks;
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
using Image = SixLabors.ImageSharp.Image;
using Key = Ryujinx.Input.Key;
using MissingKeyException = LibHac.Common.Keys.MissingKeyException;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
using ShaderCacheLoadingState = Ryujinx.Graphics.Gpu.Shader.ShaderCacheState;
Ava GUI: Restructure `Ryujinx.Ava` (#4165) * Restructure `Ryujinx.Ava` * Stylistic consistency * Update Ryujinx.Ava/UI/Controls/UserEditor.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/UserEditor.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/UserSelector.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/SaveManager.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Controls/SaveManager.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Windows/SettingsWindow.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Windows/SettingsWindow.axaml.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/ViewModels/UserProfileViewModel.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/ViewModels/UserProfileViewModel.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/UI/Helpers/EmbeddedWindow.cs Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Fix redundancies * Remove redunancies * Add back elses Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com>
2022-12-29 14:24:05 +00:00
namespace Ryujinx.Ava.UI.ViewModels
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public class MainWindowViewModel : BaseModel
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
private const int HotKeyPressDelayMs = 500;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
private ObservableCollection<ApplicationData> _applications;
private string _aspectStatusText;
private string _loadHeading;
private string _cacheLoadStatus;
private string _searchText;
private Timer _searchTimer;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
private string _dockedStatusText;
private string _fifoStatusText;
private string _gameStatusText;
private string _volumeStatusText;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
private string _gpuStatusText;
private bool _isAmiiboRequested;
private bool _isGameRunning;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private bool _isFullScreen;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
private int _progressMaximum;
private int _progressValue;
private long _lastFullscreenToggle = Environment.TickCount64;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
private bool _showLoadProgress;
private bool _showMenuAndStatusBar = true;
private bool _showStatusSeparator;
private Brush _progressBarForegroundColor;
private Brush _progressBarBackgroundColor;
private Brush _vsyncColor;
private byte[] _selectedIcon;
private bool _isAppletMenuActive;
private int _statusBarProgressMaximum;
private int _statusBarProgressValue;
private bool _isPaused;
private bool _showContent = true;
private bool _isLoadingIndeterminate = true;
private bool _showAll;
private string _lastScannedAmiiboId;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private bool _statusBarVisible;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
private ReadOnlyObservableCollection<ApplicationData> _appsObservableList;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private string _showUiKey = "F4";
private string _pauseKey = "F5";
private string _screenshotKey = "F8";
private float _volume;
private string _backendText;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
private bool _canUpdate = true;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private Cursor _cursor;
private string _title;
private string _currentEmulatedGamePath;
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
private readonly AutoResetEvent _rendererWaitEvent;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private WindowState _windowState;
private double _windowWidth;
private double _windowHeight;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private bool _isActive;
public ApplicationData ListSelectedApplication;
public ApplicationData GridSelectedApplication;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private string TitleName { get; set; }
internal AppHost AppHost { get; set; }
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public MainWindowViewModel()
{
Applications = new ObservableCollection<ApplicationData>();
Applications.ToObservableChangeSet()
.Filter(Filter)
.Sort(GetComparer())
.Bind(out _appsObservableList).AsObservableList();
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
_rendererWaitEvent = new AutoResetEvent(false);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
if (Program.PreviewerDetached)
{
UI - Avalonia Part 2 (#3351) * add settings windows and children views * Expose hotkeys configuration on the UI * Remove double spacing from locale JSON * simplify button assigner * add cemuhook buttons and title to locale * move common button assigner to own class * cancel button assigner when window is closed * remove unused setting * address review. fix controller profile not loading default when switching devices * fix updater file name * Input cleanup (#37) * addressed review * add device type to controller device checks * change accessibility modifier of public classes to internal * Update Ryujinx.Ava/Ui/ViewModels/ControllerSettingsViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update de_DE.json * Update de_DE.json * Update tr_TR.json Translated newly added lines * Update it_IT.json * fix rebase * update avalonia * fix wrong key used for button text * Align settings window elements * Tabs to spaces * Update brazilian portuguese translation * Minor improvement on brazilian portuguese translation * fix turkish translation * remove unused text * change view related classes to public * unsubscribe from deferred event if dialog is closed * Load the default language before loading any other when switching languages * Make controller settings more compact * increase default width of settings window, reduce profile buttons width Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com>
2022-07-05 18:06:31 +00:00
LoadConfigurableHotKeys();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Volume = ConfigurationState.Instance.System.AudioVolume;
}
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public void Initialize(
ContentManager contentManager,
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
IStorageProvider storageProvider,
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ApplicationLibrary applicationLibrary,
VirtualFileSystem virtualFileSystem,
AccountManager accountManager,
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
InputManager inputManager,
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
UserChannelPersistence userChannelPersistence,
LibHacHorizonManager libHacHorizonManager,
IHostUiHandler uiHandler,
Action<bool> showLoading,
Action<bool> switchToGameControl,
Action<Control> setMainContent,
TopLevel topLevel)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ContentManager = contentManager;
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
StorageProvider = storageProvider;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ApplicationLibrary = applicationLibrary;
VirtualFileSystem = virtualFileSystem;
AccountManager = accountManager;
InputManager = inputManager;
UserChannelPersistence = userChannelPersistence;
LibHacHorizonManager = libHacHorizonManager;
UiHandler = uiHandler;
ShowLoading = showLoading;
SwitchToGameControl = switchToGameControl;
SetMainContent = setMainContent;
TopLevel = topLevel;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
#region Properties
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public string SearchText
{
get => _searchText;
set
{
_searchText = value;
_searchTimer?.Dispose();
_searchTimer = new Timer(TimerCallback, null, 1000, 0);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}
private void TimerCallback(object obj)
{
RefreshView();
_searchTimer.Dispose();
_searchTimer = null;
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public bool CanUpdate
{
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
get => _canUpdate && EnableNonGameRunningControls && Updater.CanUpdate(false);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
set
{
_canUpdate = value;
OnPropertyChanged();
}
}
public Cursor Cursor
{
get => _cursor;
set
{
_cursor = value;
OnPropertyChanged();
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public ReadOnlyObservableCollection<ApplicationData> AppsObservableList
{
get => _appsObservableList;
set
{
_appsObservableList = value;
OnPropertyChanged();
}
}
public bool IsPaused
{
get => _isPaused;
set
{
_isPaused = value;
OnPropertyChanged();
}
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public long LastFullscreenToggle
{
get => _lastFullscreenToggle;
set
{
_lastFullscreenToggle = value;
OnPropertyChanged();
}
}
public bool StatusBarVisible
{
get => _statusBarVisible && EnableNonGameRunningControls;
set
{
_statusBarVisible = value;
OnPropertyChanged();
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public bool EnableNonGameRunningControls => !IsGameRunning;
public bool ShowFirmwareStatus => !ShowLoadProgress;
public bool IsGameRunning
{
get => _isGameRunning;
set
{
_isGameRunning = value;
if (!value)
{
ShowMenuAndStatusBar = false;
}
OnPropertyChanged();
OnPropertyChanged(nameof(EnableNonGameRunningControls));
OnPropertyChanged(nameof(IsAppletMenuActive));
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
OnPropertyChanged(nameof(StatusBarVisible));
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
OnPropertyChanged(nameof(ShowFirmwareStatus));
}
}
public bool IsAmiiboRequested
{
get => _isAmiiboRequested && _isGameRunning;
set
{
_isAmiiboRequested = value;
OnPropertyChanged();
}
}
public bool ShowLoadProgress
{
get => _showLoadProgress;
set
{
_showLoadProgress = value;
OnPropertyChanged();
OnPropertyChanged(nameof(ShowFirmwareStatus));
}
}
public string GameStatusText
{
get => _gameStatusText;
set
{
_gameStatusText = value;
OnPropertyChanged();
}
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public bool IsFullScreen
{
get => _isFullScreen;
set
{
_isFullScreen = value;
OnPropertyChanged();
}
}
public bool ShowAll
{
get => _showAll;
set
{
_showAll = value;
OnPropertyChanged();
}
}
public string LastScannedAmiiboId
{
get => _lastScannedAmiiboId;
set
{
_lastScannedAmiiboId = value;
OnPropertyChanged();
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public ApplicationData SelectedApplication
{
get
{
return Glyph switch
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Glyph.List => ListSelectedApplication,
Glyph.Grid => GridSelectedApplication,
_ => null,
};
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
public bool OpenUserSaveDirectoryEnabled => !SelectedApplication.ControlHolder.ByteSpan.IsZeros() && SelectedApplication.ControlHolder.Value.UserAccountSaveDataSize > 0;
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
public bool OpenDeviceSaveDirectoryEnabled => !SelectedApplication.ControlHolder.ByteSpan.IsZeros() && SelectedApplication.ControlHolder.Value.DeviceSaveDataSize > 0;
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
public bool OpenBcatSaveDirectoryEnabled => !SelectedApplication.ControlHolder.ByteSpan.IsZeros() && SelectedApplication.ControlHolder.Value.BcatDeliveryCacheStorageSize > 0;
Add "Create Shortcut" To app context menu (#4734) * Added basic implementation for shortcut creation Currently bitmaps (.bmp) are used as the source file, colours are good (unlike .ico rn) but are scaled poorly on desktop. * Icons display properly in shortcut * code cleanup * Moved shortcut logic to specific file, added Ava UI for shortcuts * Added linux .desktop shortcut creation * fixes to .shortcut data * code issue fixes * Added basic implementation for shortcut creation Currently bitmaps (.bmp) are used as the source file, colours are good (unlike .ico rn) but are scaled poorly on desktop. * Icons display properly in shortcut * code cleanup * Moved shortcut logic to specific file, added Ava UI for shortcuts * Added linux .desktop shortcut creation * fixes to .shortcut data * code issue fixes * added back shortcut to new contextmenu file * Replaced COM reference with ComImport for shortcut functionality * remove specific platform values and regions * Move ShortcutHelper to Ryujinx.Ui.Common.Helpers * Adjust styling and structure * code feedback changes * Added MacOS support using .app folder * Added basic implementation for shortcut creation Currently bitmaps (.bmp) are used as the source file, colours are good (unlike .ico rn) but are scaled poorly on desktop. * Icons display properly in shortcut * code cleanup * Moved shortcut logic to specific file, added Ava UI for shortcuts * Added linux .desktop shortcut creation * fixes to .shortcut data * code issue fixes * Added basic implementation for shortcut creation Currently bitmaps (.bmp) are used as the source file, colours are good (unlike .ico rn) but are scaled poorly on desktop. * Icons display properly in shortcut * code cleanup * Moved shortcut logic to specific file, added Ava UI for shortcuts * Added linux .desktop shortcut creation * fixes to .shortcut data * code issue fixes * Replaced COM reference with ComImport for shortcut functionality * remove specific platform values and regions * Move ShortcutHelper to Ryujinx.Ui.Common.Helpers * Adjust styling and structure * code feedback changes * adjust tooltip message * added shortcut-template.desktop file * set shortcut icon location to .local/share/icons * Linux code feedback changes * change InteropServices to new securifybv.ShellLink Package * added ShellLink to readme, updated shortcut comment * Code feedback changes * Added MacOS Support (As per Jose Estrada's PR) * dotnet format * Small restructuring * Embed template files into Ryujinx.Ui.Common * Disable "CreateShortcut" option for flatpak builds --------- Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com> Co-authored-by: Jose Estrada <joseestradacobo@gmail.com>
2023-10-20 18:51:15 +00:00
public bool CreateShortcutEnabled => !ReleaseInformation.IsFlatHubBuild();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public string LoadHeading
{
get => _loadHeading;
set
{
_loadHeading = value;
OnPropertyChanged();
}
}
public string CacheLoadStatus
{
get => _cacheLoadStatus;
set
{
_cacheLoadStatus = value;
OnPropertyChanged();
}
}
public Brush ProgressBarBackgroundColor
{
get => _progressBarBackgroundColor;
set
{
_progressBarBackgroundColor = value;
OnPropertyChanged();
}
}
public Brush ProgressBarForegroundColor
{
get => _progressBarForegroundColor;
set
{
_progressBarForegroundColor = value;
OnPropertyChanged();
}
}
public Brush VsyncColor
{
get => _vsyncColor;
set
{
_vsyncColor = value;
OnPropertyChanged();
}
}
public byte[] SelectedIcon
{
get => _selectedIcon;
set
{
_selectedIcon = value;
OnPropertyChanged();
}
}
public int ProgressMaximum
{
get => _progressMaximum;
set
{
_progressMaximum = value;
OnPropertyChanged();
}
}
public int ProgressValue
{
get => _progressValue;
set
{
_progressValue = value;
OnPropertyChanged();
}
}
public int StatusBarProgressMaximum
{
get => _statusBarProgressMaximum;
set
{
_statusBarProgressMaximum = value;
OnPropertyChanged();
}
}
public int StatusBarProgressValue
{
get => _statusBarProgressValue;
set
{
_statusBarProgressValue = value;
OnPropertyChanged();
}
}
public string FifoStatusText
{
get => _fifoStatusText;
set
{
_fifoStatusText = value;
OnPropertyChanged();
}
}
Vulkan backend (#2518) * WIP Vulkan implementation * No need to initialize attributes on the SPIR-V backend anymore * Allow multithreading shaderc and vkCreateShaderModule You'll only really see the benefit here with threaded-gal or parallel shader cache compile. Fix shaderc multithreaded changes Thread safety for shaderc Options constructor Dunno how they managed to make a constructor not thread safe, but you do you. May avoid some freezes. * Support multiple levels/layers for blit. Fixes MK8D when scaled, maybe a few other games. AMD software "safe" blit not supported right now. * TextureStorage should hold a ref of the foreign storage, otherwise it might be freed while in use * New depth-stencil blit method for AMD * Workaround for AMD driver bug * Fix some tessellation related issues (still doesn't work?) * Submit command buffer before Texture GetData. (UE4 fix) * DrawTexture support * Fix BGRA on OpenGL backend * Fix rebase build break * Support format aliasing on SetImage * Fix uniform buffers being lost when bindings are out of order * Fix storage buffers being lost when bindings are out of order (also avoid allocations when changing bindings) * Use current command buffer for unscaled copy (perf) Avoids flushing commands and renting a command buffer when fulfilling copy dependencies and when games do unscaled copies. * Update to .net6 * Update Silk.NET to version 2.10.1 Somehow, massive performance boost. Seems like their vtable for looking up vulkan methods was really slow before. * Fix PrimitivesGenerated query, disable Transform Feedback queries for now Lets Splatoon 2 work on nvidia. (mostly) * Update counter queue to be similar to the OGL one Fixes softlocks when games had to flush counters. * Don't throw when ending conditional rendering for now This should be re-enabled when conditional rendering is enabled on nvidia etc. * Update findMSB/findLSB to match master's instruction enum * Fix triangle overlay on SMO, Captain Toad, maybe others? * Don't make Intel Mesa pay for Intel Windows bugs * Fix samplers with MinFilter Linear or Nearest (fixes New Super Mario Bros U Deluxe black borders) * Update Spv.Generator * Add alpha test emulation on shader (but no shader specialisation yet...) * Fix R4G4B4A4Unorm texture format permutation * Validation layers should be enabled for any log level other than None * Add barriers around vkCmdCopyImage Write->Read barrier for src image (we want to wait for a write to read it) Write->Read barrier for dst image (we want to wait for the copy to complete before use) * Be a bit more careful with texture access flags, since it can be used for anything * Device local mapping for all buffers May avoid issues with drivers with NVIDIA on linux/older gpus on windows when using large buffers (?) Also some performance things and fixes issues with opengl games loading textures weird. * Cleanup, disable device local buffers for now. * Add single queue support Multiqueue seems to be a bit more responsive on NVIDIA. Should fix texture flush on intel. AMD has been forced to single queue for an experiment. * Fix some validation errors around extended dynamic state * Remove Intel bug workaround, it was fixed on the latest driver * Use circular queue for checking consumption on command buffers Speeds up games that spam command buffers a little. Avoids checking multiple command buffers if multiple are active at once. * Use SupportBufferUpdater, add single layer flush * Fix counter queue leak when game decides to use host conditional rendering * Force device local storage for textures (fixes linux performance) * Port #3019 * Insert barriers around vkCmdBlitImage (may fix some amd flicker) * Fix transform feedback on Intel, gl_Position feedback and clears to inexistent depth buffers * Don't pause transform feedback for multi draw * Fix draw outside of render pass and missing capability * Workaround for wrong last attribute on AMD (affects FFVII, STRIKERS1945, probably more) * Better workaround for AMD vertex buffer size alignment issue * More instructions + fixes on SPIR-V backend * Allow custom aspect ratio on Vulkan * Correct GTK UI status bar positions * SPIR-V: Functions must always end with a return * SPIR-V: Fix ImageQuerySizeLod * SPIR-V: Set DepthReplacing execution mode when FragDepth is modified * SPIR-V: Implement LoopContinue IR instruction * SPIR-V: Geometry shader support * SPIR-V: Use correct binding number on storage buffers array * Reduce allocations for Spir-v serialization Passes BinaryWriter instead of the stream to Write and WriteOperand - Removes creation of BinaryWriter for each instruction - Removes allocations for literal string * Some optimizations to Spv.Generator - Dictionary for lookups of type declarations, constants, extinst - LiteralInteger internal data format -> ushort - Deterministic HashCode implementation to avoid spirv result not being the same between runs - Inline operand list instead of List<T>, falls back to array if many operands. (large performance boost) TODO: improve instruction allocation, structured program creator, ssa? * Pool Spv.Generator resources, cache delegates, spv opts - Pools for Instructions and LiteralIntegers. Can be passed in when creating the generator module. - NewInstruction is called instead of new Instruction() - Ryujinx SpirvGenerator passes in some pools that are static. The idea is for these to be shared between threads eventually. - Estimate code size when creating the output MemoryStream - LiteralInteger pools using ThreadStatic pools that are initialized before and after creation... not sure of a better way since the way these are created is via implicit cast. Also, cache delegates for Spv.Generator for functions that are passed around to GenerateBinary etc, since passing the function raw creates a delegate on each call. TODO: update python spv cs generator to make the coregrammar with NewInstruction and the `params` overloads. * LocalDefMap for Ssa Rewriter Rather than allocating a large array of all registers for each block in the shader, allocate one array of all registers and clear it between blocks. Reduces allocations in the shader translator. * SPIR-V: Transform feedback support * SPIR-V: Fragment shader interlock support (and image coherency) * SPIR-V: Add early fragment tests support * SPIR-V: Implement SwizzleAdd, add missing Triangles ExecutionMode for geometry shaders, remove SamplerType field from TextureMeta * Don't pass depth clip state right now (fix decals) Explicitly disabling it is incorrect. OpenGL currently automatically disables based on depth clamp, which is the behaviour if this state is omitted. * Multisampling support * Multisampling: Use resolve if src samples count > dst samples count * Multisampling: We can only resolve for unscaled copies * SPIR-V: Only add FSI exec mode if used. * SPIR-V: Use ConstantComposite for Texture Offset Vector Fixes a bunch of freezes with SPIR-V on AMD hardware, and validation errors. Note: Obviously assumes input offsets are constant, which they currently are. * SPIR-V: Don't OpReturn if we already OpExit'ed Fixes spir-v parse failure and stack smashing in RADV (obviously you still need bolist) * SPIR-V: Only use input attribute type for input attributes Output vertex attributes should always be of type float. * Multithreaded Pipeline Compilation * Address some feedback * Make this 32 * Update topology with GpuAccessorState * Cleanup for merge (note: disables spir-v) * Make more robust to shader compilation failure - Don't freeze when GLSL compilation fails - Background SPIR-V pipeline compile failure results in skipped draws, similar to GLSL compilation failure. * Fix Multisampling * Only update fragment scale count if a vertex texture needs a scale. Fixes a performance regression introduced by texture scaling in the vertex stage where support buffer updates would be very frequent, even at 1x, if any textures were used on the vertex stage. This check doesn't exactly look cheap (a flag in the shader stage would probably be preferred), but it is much cheaper than uploading scales in both vulkan and opengl, so it will do for now. * Use a bitmap to do granular tracking for buffer uploads. This path is only taken if the much faster check of "is the buffer rented at all" is triggered, so it doesn't actually end up costing too much, and the time saved by not ending render passes (and on gpu for not waiting on barriers) is probably helpful. Avoids ending render passes to update buffer data (not all the time) - 140-180 to 35-45 in SMO metro kingdom (these updates are in the UI) - Very variable 60-150(!) to 16-25 in mario kart 8 (these updates are in the UI) As well as allowing more data to be preloaded persistently, this will also allow more data to be loaded in the preload buffer, which should be faster as it doesn't need to insert barriers between draws. (and on tbdr, does not need to flush and reload tile memory) Improves performance in GPU limited scenarios. Should notably improve performance on TBDR gpus. Still a lot more to do here. * Copy query results after RP ends, rather than ending to copy We need to end the render pass to get the data (submit command buffer) anyways... Reduces render passes created in games that use queries. * Rework Query stuff a bit to avoid render pass end Tries to reset returned queries in background when possible, rather than ending the render pass. Still ends render pass when resetting a counter after draws, but maybe that can be solved too. (by just pulling an empty object off the pool?) * Remove unnecessary lines Was for testing * Fix validation error for query reset Need to think of a better way to do this. * SPIR-V: Fix SwizzleAdd and some validation errors * SPIR-V: Implement attribute indexing and StoreAttribute * SPIR-V: Fix TextureSize for MS and Buffer sampler types * Fix relaunch issues * SPIR-V: Implement LogicalExclusiveOr * SPIR-V: Constant buffer indexing support * Ignore unsupported attributes rather than throwing (matches current GLSL behaviour) * SPIR-V: Implement tessellation support * SPIR-V: Geometry shader passthrough support * SPIR-V: Implement StoreShader8/16 and StoreStorage8/16 * SPIR-V: Resolution scale support and fix TextureSample multisample with LOD bug * SPIR-V: Fix field index for scale count * SPIR-V: Fix another case of wrong field index * SPIRV/GLSL: More scaling related fixes * SPIR-V: Fix ImageLoad CompositeExtract component type * SPIR-V: Workaround for Intel FrontFacing bug * Enable SPIR-V backend by default * Allow null samplers (samplers are not required when only using texelFetch to access the texture) * Fix some validation errors related to texel block view usage flag and invalid image barrier base level * Use explicit subgroup size if we can (might fix some block flickering on AMD) * Take componentMask and scissor into account when clearing framebuffer attachments * Add missing barriers around CmdFillBuffer (fixes Monster Hunter Rise flickering on NVIDIA) * Use ClampToEdge for Clamp sampler address mode on Vulkan (fixes Hollow Knight) Clamp is unsupported on Vulkan, but ClampToEdge behaves almost the same. ClampToBorder on the other hand (which was being used before) is pretty different * Shader specialization for new Vulkan required state (fixes remaining alpha test issues, vertex stretching on AMD on Crash Bandicoot, etc) * Check if the subgroup size is supported before passing a explicit size * Only enable ShaderFloat64 if the GPU supports it * We don't need to recompile shaders if alpha test state changed but alpha test is disabled * Enable shader cache on Vulkan and implement MultiplyHighS32/U32 on SPIR-V (missed those before) * Fix pipeline state saving before it is updated. This should fix a few warnings and potential stutters due to bad pipeline states being saved in the cache. You may need to clear your guest cache. * Allow null samplers on OpenGL backend * _unit0Sampler should be set only for binding 0 * Remove unused PipelineConverter format variable (was causing IOR) * Raise textures limit to 64 on Vulkan * No need to pack the shader binaries if shader cache is disabled * Fix backbuffer not being cleared and scissor not being re-enabled on OpenGL * Do not clear unbound framebuffer color attachments * Geometry shader passthrough emulation * Consolidate UpdateDepthMode and GetDepthMode implementation * Fix A1B5G5R5 texture format and support R4G4 on Vulkan * Add barrier before use of some modified images * Report 32 bit query result on AMD windows (smo issue) * Add texture recompression support (disabled for now) It recompresses ASTC textures into BC7, which might reduce VRAM usage significantly on games that uses ASTC textures * Do not report R4G4 format as supported on Vulkan It was causing mario head to become white on Super Mario 64 (???) * Improvements to -1 to 1 depth mode. - Transformation is only applied on the last stage in the vertex pipeline. - Should fix some issues with geometry and tessellation (hopefully) - Reading back FragCoord Z on fragment will transform back to -1 to 1. * Geometry Shader index count from ThreadsPerInputPrimitive Generally fixes SPIR-V emitting too many triangles, may change games in OpenGL * Remove gl_FragDepth scaling This is always 0-1; the other two issues were causing the problems. Fixes regression with Xenoblade. * Add Gl StencilOp enum values to Vulkan * Update guest cache to v1.1 (due to specialization state changes) This will explode your shader cache from earlier vulkan build, but it must be done. :pensive: * Vulkan/SPIR-V support for viewport inverse * Fix typo * Don't create query pools for unsupported query types * Return of the Vector Indexing Bug One day, everyone will get this right. * Check for transform feedback query support Sometimes transform feedback is supported without the query type. * Fix gl_FragCoord.z transformation FragCoord.z is always in 0-1, even when the real depth range is -1 to 1. Turns out the only bug was geo and tess stage outputs. Fixes Pokemon Sword/Shield, possibly others. * Fix Avalonia Rebase Vulkan is currently not available on Avalonia, but the build does work and you can use opengl. * Fix headless build * Add support for BC6 and BC7 decompression, decompress all BC formats if they are not supported by the host * Fix BCn 4/5 conversion, GetTextureTarget BCn 4/5 could generate invalid data when a line's size in bytes was not divisible by 4, which both backends expect. GetTextureTarget was not creating a view with the replacement format. * Fix dependency * Fix inverse viewport transform vector type on SPIR-V * Do not require null descriptors support * If MultiViewport is not supported, do not try to set more than one viewport/scissor * Bounds check on bitmap add. * Flush queries on attachment change rather than program change Occlusion queries are usually used in a depth only pass so the attachments changing is a better indication of the query block ending. Write mask changes are also considered since some games do depth only pass by setting 0 write mask on all the colour targets. * Add support for avalonia (#6) * add avalonia support * only lock around skia flush * addressed review * cleanup * add fallback size if avalonia attempts to render but the window size is 0. read desktop scale after enabling dpi check * fix getting window handle on linux. skip render is size is 0 * Combine non-buffer with buffer image descriptor sets * Support multisample texture copy with automatic resolve on Vulkan * Remove old CompileShader methods from the Vulkan backend * Add minimal pipeline layouts that only contains used bindings They are used by helper shaders, the intention is avoiding needing to recompile the shaders (from GLSL to SPIR-V) if the bindings changes on the translated guest shaders * Pre-compile helper shader as SPIR-V, and some fixes * Remove pre-compiled shaderc binary for Windows as its no longer needed by default * Workaround RADV crash Enabling the descriptor indexing extension, even if it is not used, forces the radv driver to use "bolist". * Use RobustBufferAccess on NVIDIA gpus Avoids the SMO waterfall triangle on older NVIDIA gpus. * Implement GPU selector and expose texture recompression on the UI and config * Fix and enable background compute shader compilation Also disables warnings from shader cache pipeline misses. * Fix error due to missing subpass dependency when Attachment Write -> Shader Read barriers are added * If S8D24 is not supported, use D32FS8 * Ensure all fences are destroyed on dispose * Pre-allocate arrays up front on DescriptorSetUpdater, allows the removal of some checks * Add missing clear layer parameter after rebase * Use selected gpu from config for avalonia (#7) * use configured device * address review * Fix D32S8 copy workaround (AMD) Fixes water in Pokemon Legends Arceus on AMD GPUs. Possibly fixes other things. * Use push descriptors for uniform buffer updates (disabled for now) * Push descriptor support check, buffer redundancy checks Should make push descriptors faster, needs more testing though. * Increase light command buffer pool to 2 command buffers, throw rather than returning invalid cbs * Adjust bindings array sizes * Force submit command buffers if memory in use by its resources is high * Add workaround for AMD GCN cubemap view sins `ImageCreateCubeCompatibleBit` seems to generally break 2D array textures with mipmaps... even if they are eventually aliased as a cubemap with mipmaps. Forcing a copy here works around the issue. This could be used in future if enabling this bit reduces performance on certain GPUs. (mobile class is generally a worry) Currently also enabled on Linux as I don't know if they managed to dodge this bug (someone please tell me). Not enabled on Vega at the moment, but easy to add if the issue is there. * Add mobile, non-RX variants to the GCN regex. Also make sure that the 3 digit ones only include numbers starting with 7 or 8. * Increase image limit per stage from 8 to 16 Xenoblade Chronicles 2 was hiting the limit of 8 * Minor code cleanup * Fix NRE caused by SupportBufferUpdater calling pipeline ClearBuffer * Add gpu selector to Avalonia (#8) * Add gpu selector to avalonia settings * show backend label on window * some fixes * address review * Minor changes to the Avalonia UI * Update graphics window UI and locales. (#9) * Update xaml and update locales * locale updates Did my best here but likely needs to be checked by native speakers, especially the use of ampersands in greek, russian and turkish? * Fix locales with more (?) correct translations. * add separator to render widget * fix spanish and portuguese * Add new IdList, replaces buffer list that could not remove elements and had unbounded growth * Don't crash the settings window if Vulkan is not supported * Fix Actions menu not being clickable on GTK UI after relaunch * Rename VulkanGraphicsDevice to VulkanRenderer and Renderer to OpenGLRenderer * Fix IdList and make it not thread safe * Revert useless OpenGL format table changes * Fix headless project build * List throws ArgumentOutOfRangeException * SPIR-V: Fix tessellation * Increase shader cache version due to tessellation fix * Reduce number of Sync objects created (improves perf in some specific titles) * Fix vulkan validation errors for NPOT compressed upload and GCN workaround. * Add timestamp to the shader cache and force rebuild if host cache is outdated * Prefer Mail box present mode for popups (#11) * Prefer Mail box present mode * fix debug * switch present mode when vsync is toggled * only disable vsync on the main window * SPIR-V: Fix geometry shader input load with transform feedback * BC7 Encoder: Prefer more precision on alpha rather than RGB when alpha is 0 * Fix Avalonia build * Address initial PR feedback * Only set transform feedback outputs on last vertex stage * Address riperiperi PR feedback * Remove outdated comment * Remove unused constructor * Only throw for negative results * Throw for QueueSubmit and other errors No point in delaying the inevitable * Transform feedback decorations inside gl_PerVertex struct breaks the NVIDIA compiler * Fix some resolution scale issues * No need for two UpdateScale calls * Fix comments on SPIR-V generator project * Try to fix shader local memory size On DOOM, a shader is using local memory, but both Low and High size are 0, CRS size is 1536, it seems to store on that region? * Remove RectangleF that is now unused * Fix ImageGather with multiple offsets Needs ImageGatherExtended capability, and must use `ConstantComposite` instead of `CompositeConstruct` * Address PR feedback from jD in all projects except Avalonia * Address most of jD PR feedback on Avalonia * Remove unsafe * Fix VulkanSkiaGpu * move present mode request out of Create Swapchain method * split more parts of create swapchain * addressed reviews * addressed review * Address second batch of jD PR feedback * Fix buffer <-> image copy row length and height alignment AlignUp helper does not support NPOT alignment, and ASTC textures can have NPOT block sizes * Better fix for NPOT alignment issue * Use switch expressions on Vulkan EnumConversion Thanks jD * Fix Avalonia build * Add Vulkan selection prompt on startup * Grammar fixes on Vulkan prompt message * Add missing Vulkan migration flag Co-authored-by: riperiperi <rhy3756547@hotmail.com> Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com>
2022-07-31 21:26:06 +00:00
public string GpuNameText
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
get => _gpuStatusText;
set
{
_gpuStatusText = value;
OnPropertyChanged();
}
}
Vulkan backend (#2518) * WIP Vulkan implementation * No need to initialize attributes on the SPIR-V backend anymore * Allow multithreading shaderc and vkCreateShaderModule You'll only really see the benefit here with threaded-gal or parallel shader cache compile. Fix shaderc multithreaded changes Thread safety for shaderc Options constructor Dunno how they managed to make a constructor not thread safe, but you do you. May avoid some freezes. * Support multiple levels/layers for blit. Fixes MK8D when scaled, maybe a few other games. AMD software "safe" blit not supported right now. * TextureStorage should hold a ref of the foreign storage, otherwise it might be freed while in use * New depth-stencil blit method for AMD * Workaround for AMD driver bug * Fix some tessellation related issues (still doesn't work?) * Submit command buffer before Texture GetData. (UE4 fix) * DrawTexture support * Fix BGRA on OpenGL backend * Fix rebase build break * Support format aliasing on SetImage * Fix uniform buffers being lost when bindings are out of order * Fix storage buffers being lost when bindings are out of order (also avoid allocations when changing bindings) * Use current command buffer for unscaled copy (perf) Avoids flushing commands and renting a command buffer when fulfilling copy dependencies and when games do unscaled copies. * Update to .net6 * Update Silk.NET to version 2.10.1 Somehow, massive performance boost. Seems like their vtable for looking up vulkan methods was really slow before. * Fix PrimitivesGenerated query, disable Transform Feedback queries for now Lets Splatoon 2 work on nvidia. (mostly) * Update counter queue to be similar to the OGL one Fixes softlocks when games had to flush counters. * Don't throw when ending conditional rendering for now This should be re-enabled when conditional rendering is enabled on nvidia etc. * Update findMSB/findLSB to match master's instruction enum * Fix triangle overlay on SMO, Captain Toad, maybe others? * Don't make Intel Mesa pay for Intel Windows bugs * Fix samplers with MinFilter Linear or Nearest (fixes New Super Mario Bros U Deluxe black borders) * Update Spv.Generator * Add alpha test emulation on shader (but no shader specialisation yet...) * Fix R4G4B4A4Unorm texture format permutation * Validation layers should be enabled for any log level other than None * Add barriers around vkCmdCopyImage Write->Read barrier for src image (we want to wait for a write to read it) Write->Read barrier for dst image (we want to wait for the copy to complete before use) * Be a bit more careful with texture access flags, since it can be used for anything * Device local mapping for all buffers May avoid issues with drivers with NVIDIA on linux/older gpus on windows when using large buffers (?) Also some performance things and fixes issues with opengl games loading textures weird. * Cleanup, disable device local buffers for now. * Add single queue support Multiqueue seems to be a bit more responsive on NVIDIA. Should fix texture flush on intel. AMD has been forced to single queue for an experiment. * Fix some validation errors around extended dynamic state * Remove Intel bug workaround, it was fixed on the latest driver * Use circular queue for checking consumption on command buffers Speeds up games that spam command buffers a little. Avoids checking multiple command buffers if multiple are active at once. * Use SupportBufferUpdater, add single layer flush * Fix counter queue leak when game decides to use host conditional rendering * Force device local storage for textures (fixes linux performance) * Port #3019 * Insert barriers around vkCmdBlitImage (may fix some amd flicker) * Fix transform feedback on Intel, gl_Position feedback and clears to inexistent depth buffers * Don't pause transform feedback for multi draw * Fix draw outside of render pass and missing capability * Workaround for wrong last attribute on AMD (affects FFVII, STRIKERS1945, probably more) * Better workaround for AMD vertex buffer size alignment issue * More instructions + fixes on SPIR-V backend * Allow custom aspect ratio on Vulkan * Correct GTK UI status bar positions * SPIR-V: Functions must always end with a return * SPIR-V: Fix ImageQuerySizeLod * SPIR-V: Set DepthReplacing execution mode when FragDepth is modified * SPIR-V: Implement LoopContinue IR instruction * SPIR-V: Geometry shader support * SPIR-V: Use correct binding number on storage buffers array * Reduce allocations for Spir-v serialization Passes BinaryWriter instead of the stream to Write and WriteOperand - Removes creation of BinaryWriter for each instruction - Removes allocations for literal string * Some optimizations to Spv.Generator - Dictionary for lookups of type declarations, constants, extinst - LiteralInteger internal data format -> ushort - Deterministic HashCode implementation to avoid spirv result not being the same between runs - Inline operand list instead of List<T>, falls back to array if many operands. (large performance boost) TODO: improve instruction allocation, structured program creator, ssa? * Pool Spv.Generator resources, cache delegates, spv opts - Pools for Instructions and LiteralIntegers. Can be passed in when creating the generator module. - NewInstruction is called instead of new Instruction() - Ryujinx SpirvGenerator passes in some pools that are static. The idea is for these to be shared between threads eventually. - Estimate code size when creating the output MemoryStream - LiteralInteger pools using ThreadStatic pools that are initialized before and after creation... not sure of a better way since the way these are created is via implicit cast. Also, cache delegates for Spv.Generator for functions that are passed around to GenerateBinary etc, since passing the function raw creates a delegate on each call. TODO: update python spv cs generator to make the coregrammar with NewInstruction and the `params` overloads. * LocalDefMap for Ssa Rewriter Rather than allocating a large array of all registers for each block in the shader, allocate one array of all registers and clear it between blocks. Reduces allocations in the shader translator. * SPIR-V: Transform feedback support * SPIR-V: Fragment shader interlock support (and image coherency) * SPIR-V: Add early fragment tests support * SPIR-V: Implement SwizzleAdd, add missing Triangles ExecutionMode for geometry shaders, remove SamplerType field from TextureMeta * Don't pass depth clip state right now (fix decals) Explicitly disabling it is incorrect. OpenGL currently automatically disables based on depth clamp, which is the behaviour if this state is omitted. * Multisampling support * Multisampling: Use resolve if src samples count > dst samples count * Multisampling: We can only resolve for unscaled copies * SPIR-V: Only add FSI exec mode if used. * SPIR-V: Use ConstantComposite for Texture Offset Vector Fixes a bunch of freezes with SPIR-V on AMD hardware, and validation errors. Note: Obviously assumes input offsets are constant, which they currently are. * SPIR-V: Don't OpReturn if we already OpExit'ed Fixes spir-v parse failure and stack smashing in RADV (obviously you still need bolist) * SPIR-V: Only use input attribute type for input attributes Output vertex attributes should always be of type float. * Multithreaded Pipeline Compilation * Address some feedback * Make this 32 * Update topology with GpuAccessorState * Cleanup for merge (note: disables spir-v) * Make more robust to shader compilation failure - Don't freeze when GLSL compilation fails - Background SPIR-V pipeline compile failure results in skipped draws, similar to GLSL compilation failure. * Fix Multisampling * Only update fragment scale count if a vertex texture needs a scale. Fixes a performance regression introduced by texture scaling in the vertex stage where support buffer updates would be very frequent, even at 1x, if any textures were used on the vertex stage. This check doesn't exactly look cheap (a flag in the shader stage would probably be preferred), but it is much cheaper than uploading scales in both vulkan and opengl, so it will do for now. * Use a bitmap to do granular tracking for buffer uploads. This path is only taken if the much faster check of "is the buffer rented at all" is triggered, so it doesn't actually end up costing too much, and the time saved by not ending render passes (and on gpu for not waiting on barriers) is probably helpful. Avoids ending render passes to update buffer data (not all the time) - 140-180 to 35-45 in SMO metro kingdom (these updates are in the UI) - Very variable 60-150(!) to 16-25 in mario kart 8 (these updates are in the UI) As well as allowing more data to be preloaded persistently, this will also allow more data to be loaded in the preload buffer, which should be faster as it doesn't need to insert barriers between draws. (and on tbdr, does not need to flush and reload tile memory) Improves performance in GPU limited scenarios. Should notably improve performance on TBDR gpus. Still a lot more to do here. * Copy query results after RP ends, rather than ending to copy We need to end the render pass to get the data (submit command buffer) anyways... Reduces render passes created in games that use queries. * Rework Query stuff a bit to avoid render pass end Tries to reset returned queries in background when possible, rather than ending the render pass. Still ends render pass when resetting a counter after draws, but maybe that can be solved too. (by just pulling an empty object off the pool?) * Remove unnecessary lines Was for testing * Fix validation error for query reset Need to think of a better way to do this. * SPIR-V: Fix SwizzleAdd and some validation errors * SPIR-V: Implement attribute indexing and StoreAttribute * SPIR-V: Fix TextureSize for MS and Buffer sampler types * Fix relaunch issues * SPIR-V: Implement LogicalExclusiveOr * SPIR-V: Constant buffer indexing support * Ignore unsupported attributes rather than throwing (matches current GLSL behaviour) * SPIR-V: Implement tessellation support * SPIR-V: Geometry shader passthrough support * SPIR-V: Implement StoreShader8/16 and StoreStorage8/16 * SPIR-V: Resolution scale support and fix TextureSample multisample with LOD bug * SPIR-V: Fix field index for scale count * SPIR-V: Fix another case of wrong field index * SPIRV/GLSL: More scaling related fixes * SPIR-V: Fix ImageLoad CompositeExtract component type * SPIR-V: Workaround for Intel FrontFacing bug * Enable SPIR-V backend by default * Allow null samplers (samplers are not required when only using texelFetch to access the texture) * Fix some validation errors related to texel block view usage flag and invalid image barrier base level * Use explicit subgroup size if we can (might fix some block flickering on AMD) * Take componentMask and scissor into account when clearing framebuffer attachments * Add missing barriers around CmdFillBuffer (fixes Monster Hunter Rise flickering on NVIDIA) * Use ClampToEdge for Clamp sampler address mode on Vulkan (fixes Hollow Knight) Clamp is unsupported on Vulkan, but ClampToEdge behaves almost the same. ClampToBorder on the other hand (which was being used before) is pretty different * Shader specialization for new Vulkan required state (fixes remaining alpha test issues, vertex stretching on AMD on Crash Bandicoot, etc) * Check if the subgroup size is supported before passing a explicit size * Only enable ShaderFloat64 if the GPU supports it * We don't need to recompile shaders if alpha test state changed but alpha test is disabled * Enable shader cache on Vulkan and implement MultiplyHighS32/U32 on SPIR-V (missed those before) * Fix pipeline state saving before it is updated. This should fix a few warnings and potential stutters due to bad pipeline states being saved in the cache. You may need to clear your guest cache. * Allow null samplers on OpenGL backend * _unit0Sampler should be set only for binding 0 * Remove unused PipelineConverter format variable (was causing IOR) * Raise textures limit to 64 on Vulkan * No need to pack the shader binaries if shader cache is disabled * Fix backbuffer not being cleared and scissor not being re-enabled on OpenGL * Do not clear unbound framebuffer color attachments * Geometry shader passthrough emulation * Consolidate UpdateDepthMode and GetDepthMode implementation * Fix A1B5G5R5 texture format and support R4G4 on Vulkan * Add barrier before use of some modified images * Report 32 bit query result on AMD windows (smo issue) * Add texture recompression support (disabled for now) It recompresses ASTC textures into BC7, which might reduce VRAM usage significantly on games that uses ASTC textures * Do not report R4G4 format as supported on Vulkan It was causing mario head to become white on Super Mario 64 (???) * Improvements to -1 to 1 depth mode. - Transformation is only applied on the last stage in the vertex pipeline. - Should fix some issues with geometry and tessellation (hopefully) - Reading back FragCoord Z on fragment will transform back to -1 to 1. * Geometry Shader index count from ThreadsPerInputPrimitive Generally fixes SPIR-V emitting too many triangles, may change games in OpenGL * Remove gl_FragDepth scaling This is always 0-1; the other two issues were causing the problems. Fixes regression with Xenoblade. * Add Gl StencilOp enum values to Vulkan * Update guest cache to v1.1 (due to specialization state changes) This will explode your shader cache from earlier vulkan build, but it must be done. :pensive: * Vulkan/SPIR-V support for viewport inverse * Fix typo * Don't create query pools for unsupported query types * Return of the Vector Indexing Bug One day, everyone will get this right. * Check for transform feedback query support Sometimes transform feedback is supported without the query type. * Fix gl_FragCoord.z transformation FragCoord.z is always in 0-1, even when the real depth range is -1 to 1. Turns out the only bug was geo and tess stage outputs. Fixes Pokemon Sword/Shield, possibly others. * Fix Avalonia Rebase Vulkan is currently not available on Avalonia, but the build does work and you can use opengl. * Fix headless build * Add support for BC6 and BC7 decompression, decompress all BC formats if they are not supported by the host * Fix BCn 4/5 conversion, GetTextureTarget BCn 4/5 could generate invalid data when a line's size in bytes was not divisible by 4, which both backends expect. GetTextureTarget was not creating a view with the replacement format. * Fix dependency * Fix inverse viewport transform vector type on SPIR-V * Do not require null descriptors support * If MultiViewport is not supported, do not try to set more than one viewport/scissor * Bounds check on bitmap add. * Flush queries on attachment change rather than program change Occlusion queries are usually used in a depth only pass so the attachments changing is a better indication of the query block ending. Write mask changes are also considered since some games do depth only pass by setting 0 write mask on all the colour targets. * Add support for avalonia (#6) * add avalonia support * only lock around skia flush * addressed review * cleanup * add fallback size if avalonia attempts to render but the window size is 0. read desktop scale after enabling dpi check * fix getting window handle on linux. skip render is size is 0 * Combine non-buffer with buffer image descriptor sets * Support multisample texture copy with automatic resolve on Vulkan * Remove old CompileShader methods from the Vulkan backend * Add minimal pipeline layouts that only contains used bindings They are used by helper shaders, the intention is avoiding needing to recompile the shaders (from GLSL to SPIR-V) if the bindings changes on the translated guest shaders * Pre-compile helper shader as SPIR-V, and some fixes * Remove pre-compiled shaderc binary for Windows as its no longer needed by default * Workaround RADV crash Enabling the descriptor indexing extension, even if it is not used, forces the radv driver to use "bolist". * Use RobustBufferAccess on NVIDIA gpus Avoids the SMO waterfall triangle on older NVIDIA gpus. * Implement GPU selector and expose texture recompression on the UI and config * Fix and enable background compute shader compilation Also disables warnings from shader cache pipeline misses. * Fix error due to missing subpass dependency when Attachment Write -> Shader Read barriers are added * If S8D24 is not supported, use D32FS8 * Ensure all fences are destroyed on dispose * Pre-allocate arrays up front on DescriptorSetUpdater, allows the removal of some checks * Add missing clear layer parameter after rebase * Use selected gpu from config for avalonia (#7) * use configured device * address review * Fix D32S8 copy workaround (AMD) Fixes water in Pokemon Legends Arceus on AMD GPUs. Possibly fixes other things. * Use push descriptors for uniform buffer updates (disabled for now) * Push descriptor support check, buffer redundancy checks Should make push descriptors faster, needs more testing though. * Increase light command buffer pool to 2 command buffers, throw rather than returning invalid cbs * Adjust bindings array sizes * Force submit command buffers if memory in use by its resources is high * Add workaround for AMD GCN cubemap view sins `ImageCreateCubeCompatibleBit` seems to generally break 2D array textures with mipmaps... even if they are eventually aliased as a cubemap with mipmaps. Forcing a copy here works around the issue. This could be used in future if enabling this bit reduces performance on certain GPUs. (mobile class is generally a worry) Currently also enabled on Linux as I don't know if they managed to dodge this bug (someone please tell me). Not enabled on Vega at the moment, but easy to add if the issue is there. * Add mobile, non-RX variants to the GCN regex. Also make sure that the 3 digit ones only include numbers starting with 7 or 8. * Increase image limit per stage from 8 to 16 Xenoblade Chronicles 2 was hiting the limit of 8 * Minor code cleanup * Fix NRE caused by SupportBufferUpdater calling pipeline ClearBuffer * Add gpu selector to Avalonia (#8) * Add gpu selector to avalonia settings * show backend label on window * some fixes * address review * Minor changes to the Avalonia UI * Update graphics window UI and locales. (#9) * Update xaml and update locales * locale updates Did my best here but likely needs to be checked by native speakers, especially the use of ampersands in greek, russian and turkish? * Fix locales with more (?) correct translations. * add separator to render widget * fix spanish and portuguese * Add new IdList, replaces buffer list that could not remove elements and had unbounded growth * Don't crash the settings window if Vulkan is not supported * Fix Actions menu not being clickable on GTK UI after relaunch * Rename VulkanGraphicsDevice to VulkanRenderer and Renderer to OpenGLRenderer * Fix IdList and make it not thread safe * Revert useless OpenGL format table changes * Fix headless project build * List throws ArgumentOutOfRangeException * SPIR-V: Fix tessellation * Increase shader cache version due to tessellation fix * Reduce number of Sync objects created (improves perf in some specific titles) * Fix vulkan validation errors for NPOT compressed upload and GCN workaround. * Add timestamp to the shader cache and force rebuild if host cache is outdated * Prefer Mail box present mode for popups (#11) * Prefer Mail box present mode * fix debug * switch present mode when vsync is toggled * only disable vsync on the main window * SPIR-V: Fix geometry shader input load with transform feedback * BC7 Encoder: Prefer more precision on alpha rather than RGB when alpha is 0 * Fix Avalonia build * Address initial PR feedback * Only set transform feedback outputs on last vertex stage * Address riperiperi PR feedback * Remove outdated comment * Remove unused constructor * Only throw for negative results * Throw for QueueSubmit and other errors No point in delaying the inevitable * Transform feedback decorations inside gl_PerVertex struct breaks the NVIDIA compiler * Fix some resolution scale issues * No need for two UpdateScale calls * Fix comments on SPIR-V generator project * Try to fix shader local memory size On DOOM, a shader is using local memory, but both Low and High size are 0, CRS size is 1536, it seems to store on that region? * Remove RectangleF that is now unused * Fix ImageGather with multiple offsets Needs ImageGatherExtended capability, and must use `ConstantComposite` instead of `CompositeConstruct` * Address PR feedback from jD in all projects except Avalonia * Address most of jD PR feedback on Avalonia * Remove unsafe * Fix VulkanSkiaGpu * move present mode request out of Create Swapchain method * split more parts of create swapchain * addressed reviews * addressed review * Address second batch of jD PR feedback * Fix buffer <-> image copy row length and height alignment AlignUp helper does not support NPOT alignment, and ASTC textures can have NPOT block sizes * Better fix for NPOT alignment issue * Use switch expressions on Vulkan EnumConversion Thanks jD * Fix Avalonia build * Add Vulkan selection prompt on startup * Grammar fixes on Vulkan prompt message * Add missing Vulkan migration flag Co-authored-by: riperiperi <rhy3756547@hotmail.com> Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com>
2022-07-31 21:26:06 +00:00
public string BackendText
{
get => _backendText;
set
{
_backendText = value;
OnPropertyChanged();
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public string DockedStatusText
{
get => _dockedStatusText;
set
{
_dockedStatusText = value;
OnPropertyChanged();
}
}
public string AspectRatioStatusText
{
get => _aspectStatusText;
set
{
_aspectStatusText = value;
OnPropertyChanged();
}
}
public string VolumeStatusText
{
get => _volumeStatusText;
set
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
_volumeStatusText = value;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
OnPropertyChanged();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}
public bool VolumeMuted => _volume == 0;
public float Volume
{
get => _volume;
set
{
_volume = value;
if (_isGameRunning)
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
AppHost.Device.SetVolume(_volume);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
OnPropertyChanged(nameof(VolumeStatusText));
OnPropertyChanged(nameof(VolumeMuted));
OnPropertyChanged();
}
}
public bool ShowStatusSeparator
{
get => _showStatusSeparator;
set
{
_showStatusSeparator = value;
OnPropertyChanged();
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public bool ShowMenuAndStatusBar
{
get => _showMenuAndStatusBar;
set
{
_showMenuAndStatusBar = value;
OnPropertyChanged();
}
}
public bool IsLoadingIndeterminate
{
get => _isLoadingIndeterminate;
set
{
_isLoadingIndeterminate = value;
OnPropertyChanged();
}
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public bool IsActive
{
get => _isActive;
set
{
_isActive = value;
OnPropertyChanged();
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public bool ShowContent
{
get => _showContent;
set
{
_showContent = value;
OnPropertyChanged();
}
}
public bool IsAppletMenuActive
{
get => _isAppletMenuActive && EnableNonGameRunningControls;
set
{
_isAppletMenuActive = value;
OnPropertyChanged();
}
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public WindowState WindowState
{
get => _windowState;
internal set
{
_windowState = value;
OnPropertyChanged();
}
}
public double WindowWidth
{
get => _windowWidth;
set
{
_windowWidth = value;
OnPropertyChanged();
}
}
public double WindowHeight
{
get => _windowHeight;
set
{
_windowHeight = value;
OnPropertyChanged();
}
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public bool IsGrid => Glyph == Glyph.Grid;
public bool IsList => Glyph == Glyph.List;
internal void Sort(bool isAscending)
{
IsAscending = isAscending;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
RefreshView();
}
internal void Sort(ApplicationSort sort)
{
SortMode = sort;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
RefreshView();
}
public bool StartGamesInFullscreen
{
get => ConfigurationState.Instance.Ui.StartFullscreen;
set
{
ConfigurationState.Instance.Ui.StartFullscreen.Value = value;
ConfigurationState.Instance.ToFileFormat().SaveConfig(Program.ConfigurationPath);
OnPropertyChanged();
}
}
public bool ShowConsole
{
get => ConfigurationState.Instance.Ui.ShowConsole;
set
{
ConfigurationState.Instance.Ui.ShowConsole.Value = value;
ConfigurationState.Instance.ToFileFormat().SaveConfig(Program.ConfigurationPath);
OnPropertyChanged();
}
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public string Title
{
get => _title;
set
{
_title = value;
OnPropertyChanged();
}
}
public bool ShowConsoleVisible
{
get => ConsoleHelper.SetConsoleWindowStateSupported;
}
public bool ManageFileTypesVisible
{
get => FileAssociationHelper.IsTypeAssociationSupported;
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public ObservableCollection<ApplicationData> Applications
{
get => _applications;
set
{
_applications = value;
OnPropertyChanged();
}
}
public Glyph Glyph
{
get => (Glyph)ConfigurationState.Instance.Ui.GameListViewMode.Value;
set
{
ConfigurationState.Instance.Ui.GameListViewMode.Value = (int)value;
OnPropertyChanged();
OnPropertyChanged(nameof(IsGrid));
OnPropertyChanged(nameof(IsList));
ConfigurationState.Instance.ToFileFormat().SaveConfig(Program.ConfigurationPath);
}
}
public bool ShowNames
{
get => ConfigurationState.Instance.Ui.ShowNames && ConfigurationState.Instance.Ui.GridSize > 1; set
{
ConfigurationState.Instance.Ui.ShowNames.Value = value;
OnPropertyChanged();
OnPropertyChanged(nameof(GridSizeScale));
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
OnPropertyChanged(nameof(GridItemSelectorSize));
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
ConfigurationState.Instance.ToFileFormat().SaveConfig(Program.ConfigurationPath);
}
}
internal ApplicationSort SortMode
{
get => (ApplicationSort)ConfigurationState.Instance.Ui.ApplicationSort.Value;
private set
{
ConfigurationState.Instance.Ui.ApplicationSort.Value = (int)value;
OnPropertyChanged();
OnPropertyChanged(nameof(SortName));
ConfigurationState.Instance.ToFileFormat().SaveConfig(Program.ConfigurationPath);
}
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public int ListItemSelectorSize
{
get
{
return ConfigurationState.Instance.Ui.GridSize.Value switch
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
1 => 78,
2 => 100,
3 => 120,
4 => 140,
_ => 16,
};
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
}
}
public int GridItemSelectorSize
{
get
{
return ConfigurationState.Instance.Ui.GridSize.Value switch
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
1 => 120,
2 => ShowNames ? 210 : 150,
3 => ShowNames ? 240 : 180,
4 => ShowNames ? 280 : 220,
_ => 16,
};
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
}
}
public int GridSizeScale
{
get => ConfigurationState.Instance.Ui.GridSize;
set
{
ConfigurationState.Instance.Ui.GridSize.Value = value;
if (value < 2)
{
ShowNames = false;
}
OnPropertyChanged();
OnPropertyChanged(nameof(IsGridSmall));
OnPropertyChanged(nameof(IsGridMedium));
OnPropertyChanged(nameof(IsGridLarge));
OnPropertyChanged(nameof(IsGridHuge));
OnPropertyChanged(nameof(ListItemSelectorSize));
OnPropertyChanged(nameof(GridItemSelectorSize));
OnPropertyChanged(nameof(ShowNames));
ConfigurationState.Instance.ToFileFormat().SaveConfig(Program.ConfigurationPath);
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public string SortName
{
get
{
return SortMode switch
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ApplicationSort.Title => LocaleManager.Instance[LocaleKeys.GameListHeaderApplication],
ApplicationSort.Developer => LocaleManager.Instance[LocaleKeys.GameListHeaderDeveloper],
ApplicationSort.LastPlayed => LocaleManager.Instance[LocaleKeys.GameListHeaderLastPlayed],
ApplicationSort.TotalTimePlayed => LocaleManager.Instance[LocaleKeys.GameListHeaderTimePlayed],
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ApplicationSort.FileType => LocaleManager.Instance[LocaleKeys.GameListHeaderFileExtension],
ApplicationSort.FileSize => LocaleManager.Instance[LocaleKeys.GameListHeaderFileSize],
ApplicationSort.Path => LocaleManager.Instance[LocaleKeys.GameListHeaderPath],
ApplicationSort.Favorite => LocaleManager.Instance[LocaleKeys.CommonFavorite],
_ => string.Empty,
};
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}
public bool IsAscending
{
get => ConfigurationState.Instance.Ui.IsAscendingOrder;
private set
{
ConfigurationState.Instance.Ui.IsAscendingOrder.Value = value;
OnPropertyChanged();
OnPropertyChanged(nameof(SortMode));
OnPropertyChanged(nameof(SortName));
ConfigurationState.Instance.ToFileFormat().SaveConfig(Program.ConfigurationPath);
}
}
public KeyGesture ShowUiKey
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
get => KeyGesture.Parse(_showUiKey);
set
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
_showUiKey = value.ToString();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
OnPropertyChanged();
}
}
public KeyGesture ScreenshotKey
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
get => KeyGesture.Parse(_screenshotKey);
set
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
_screenshotKey = value.ToString();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
OnPropertyChanged();
}
}
public KeyGesture PauseKey
{
get => KeyGesture.Parse(_pauseKey); set
{
_pauseKey = value.ToString();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
OnPropertyChanged();
}
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public ContentManager ContentManager { get; private set; }
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
public IStorageProvider StorageProvider { get; private set; }
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public ApplicationLibrary ApplicationLibrary { get; private set; }
public VirtualFileSystem VirtualFileSystem { get; private set; }
public AccountManager AccountManager { get; private set; }
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
public InputManager InputManager { get; private set; }
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public UserChannelPersistence UserChannelPersistence { get; private set; }
public Action<bool> ShowLoading { get; private set; }
public Action<bool> SwitchToGameControl { get; private set; }
public Action<Control> SetMainContent { get; private set; }
public TopLevel TopLevel { get; private set; }
public RendererHost RendererHostControl { get; private set; }
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public bool IsClosing { get; set; }
public LibHacHorizonManager LibHacHorizonManager { get; internal set; }
public IHostUiHandler UiHandler { get; internal set; }
public bool IsSortedByFavorite => SortMode == ApplicationSort.Favorite;
public bool IsSortedByTitle => SortMode == ApplicationSort.Title;
public bool IsSortedByDeveloper => SortMode == ApplicationSort.Developer;
public bool IsSortedByLastPlayed => SortMode == ApplicationSort.LastPlayed;
public bool IsSortedByTimePlayed => SortMode == ApplicationSort.TotalTimePlayed;
public bool IsSortedByType => SortMode == ApplicationSort.FileType;
public bool IsSortedBySize => SortMode == ApplicationSort.FileSize;
public bool IsSortedByPath => SortMode == ApplicationSort.Path;
public bool IsGridSmall => ConfigurationState.Instance.Ui.GridSize == 1;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public bool IsGridMedium => ConfigurationState.Instance.Ui.GridSize == 2;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public bool IsGridLarge => ConfigurationState.Instance.Ui.GridSize == 3;
public bool IsGridHuge => ConfigurationState.Instance.Ui.GridSize == 4;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
#endregion
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
#region PrivateMethods
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private IComparer<ApplicationData> GetComparer()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
return SortMode switch
{
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
#pragma warning disable IDE0055 // Disable formatting
ApplicationSort.LastPlayed => new LastPlayedSortComparer(IsAscending),
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ApplicationSort.FileSize => IsAscending ? SortExpressionComparer<ApplicationData>.Ascending(app => app.FileSizeBytes)
: SortExpressionComparer<ApplicationData>.Descending(app => app.FileSizeBytes),
ApplicationSort.TotalTimePlayed => IsAscending ? SortExpressionComparer<ApplicationData>.Ascending(app => app.TimePlayedNum)
: SortExpressionComparer<ApplicationData>.Descending(app => app.TimePlayedNum),
ApplicationSort.Title => IsAscending ? SortExpressionComparer<ApplicationData>.Ascending(app => app.TitleName)
: SortExpressionComparer<ApplicationData>.Descending(app => app.TitleName),
ApplicationSort.Favorite => !IsAscending ? SortExpressionComparer<ApplicationData>.Ascending(app => app.Favorite)
: SortExpressionComparer<ApplicationData>.Descending(app => app.Favorite),
ApplicationSort.Developer => IsAscending ? SortExpressionComparer<ApplicationData>.Ascending(app => app.Developer)
: SortExpressionComparer<ApplicationData>.Descending(app => app.Developer),
ApplicationSort.FileType => IsAscending ? SortExpressionComparer<ApplicationData>.Ascending(app => app.FileExtension)
: SortExpressionComparer<ApplicationData>.Descending(app => app.FileExtension),
ApplicationSort.Path => IsAscending ? SortExpressionComparer<ApplicationData>.Ascending(app => app.Path)
: SortExpressionComparer<ApplicationData>.Descending(app => app.Path),
_ => null,
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
#pragma warning restore IDE0055
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
};
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public void RefreshView()
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
RefreshGrid();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private void RefreshGrid()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Applications.ToObservableChangeSet()
.Filter(Filter)
.Sort(GetComparer())
.Bind(out _appsObservableList).AsObservableList();
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
OnPropertyChanged(nameof(AppsObservableList));
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
private bool Filter(object arg)
{
if (arg is ApplicationData app)
{
return string.IsNullOrWhiteSpace(_searchText) || app.TitleName.ToLower().Contains(_searchText.ToLower());
}
return false;
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private async Task HandleFirmwareInstallation(string filename)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
try
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
SystemVersion firmwareVersion = ContentManager.VerifyFirmwarePackage(filename);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
if (firmwareVersion == null)
{
await ContentDialogHelper.CreateErrorDialog(LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.DialogFirmwareInstallerFirmwareNotFoundErrorMessage, filename));
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
return;
}
string dialogTitle = LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.DialogFirmwareInstallerFirmwareInstallTitle, firmwareVersion.VersionString);
string dialogMessage = LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.DialogFirmwareInstallerFirmwareInstallMessage, firmwareVersion.VersionString);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
SystemVersion currentVersion = ContentManager.GetCurrentFirmwareVersion();
if (currentVersion != null)
{
dialogMessage += LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.DialogFirmwareInstallerFirmwareInstallSubMessage, currentVersion.VersionString);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
}
dialogMessage += LocaleManager.Instance[LocaleKeys.DialogFirmwareInstallerFirmwareInstallConfirmMessage];
UserResult result = await ContentDialogHelper.CreateConfirmationDialog(
dialogTitle,
dialogMessage,
LocaleManager.Instance[LocaleKeys.InputDialogYes],
LocaleManager.Instance[LocaleKeys.InputDialogNo],
LocaleManager.Instance[LocaleKeys.RyujinxConfirm]);
UpdateWaitWindow waitingDialog = new(dialogTitle, LocaleManager.Instance[LocaleKeys.DialogFirmwareInstallerFirmwareInstallWaitMessage]);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
if (result == UserResult.Yes)
{
Logger.Info?.Print(LogClass.Application, $"Installing firmware {firmwareVersion.VersionString}");
Thread thread = new(() =>
{
Dispatcher.UIThread.InvokeAsync(delegate
{
waitingDialog.Show();
});
try
{
ContentManager.InstallFirmware(filename);
Dispatcher.UIThread.InvokeAsync(async delegate
{
waitingDialog.Close();
string message = LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.DialogFirmwareInstallerFirmwareInstallSuccessMessage, firmwareVersion.VersionString);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
await ContentDialogHelper.CreateInfoDialog(dialogTitle, message, LocaleManager.Instance[LocaleKeys.InputDialogOk], "", LocaleManager.Instance[LocaleKeys.RyujinxInfo]);
Logger.Info?.Print(LogClass.Application, message);
// Purge Applet Cache.
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
DirectoryInfo miiEditorCacheFolder = new(Path.Combine(AppDataManager.GamesDirPath, "0100000000001009", "cache"));
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
if (miiEditorCacheFolder.Exists)
{
miiEditorCacheFolder.Delete(true);
}
});
}
catch (Exception ex)
{
Dispatcher.UIThread.InvokeAsync(async () =>
{
waitingDialog.Close();
await ContentDialogHelper.CreateErrorDialog(ex.Message);
});
}
finally
{
RefreshFirmwareStatus();
}
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
})
{
Name = "GUI.FirmwareInstallerThread",
};
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
thread.Start();
}
}
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
catch (MissingKeyException ex)
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
if (Application.Current.ApplicationLifetime is IClassicDesktopStyleApplicationLifetime desktop)
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
Logger.Error?.Print(LogClass.Application, ex.ToString());
await UserErrorDialog.ShowUserErrorDialog(UserError.NoKeys);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
}
}
catch (Exception ex)
{
await ContentDialogHelper.CreateErrorDialog(ex.Message);
}
}
private void ProgressHandler<T>(T state, int current, int total) where T : Enum
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Dispatcher.UIThread.Post((() =>
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ProgressMaximum = total;
ProgressValue = current;
switch (state)
{
case LoadState ptcState:
CacheLoadStatus = $"{current} / {total}";
switch (ptcState)
{
case LoadState.Unloaded:
case LoadState.Loading:
LoadHeading = LocaleManager.Instance[LocaleKeys.CompilingPPTC];
IsLoadingIndeterminate = false;
break;
case LoadState.Loaded:
LoadHeading = LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.LoadingHeading, TitleName);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
IsLoadingIndeterminate = true;
CacheLoadStatus = "";
break;
}
break;
case ShaderCacheLoadingState shaderCacheState:
CacheLoadStatus = $"{current} / {total}";
switch (shaderCacheState)
{
case ShaderCacheLoadingState.Start:
case ShaderCacheLoadingState.Loading:
LoadHeading = LocaleManager.Instance[LocaleKeys.CompilingShaders];
IsLoadingIndeterminate = false;
break;
case ShaderCacheLoadingState.Packaging:
LoadHeading = LocaleManager.Instance[LocaleKeys.PackagingShaders];
IsLoadingIndeterminate = false;
break;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
case ShaderCacheLoadingState.Loaded:
LoadHeading = LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.LoadingHeading, TitleName);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
IsLoadingIndeterminate = true;
CacheLoadStatus = "";
break;
}
break;
default:
throw new ArgumentException($"Unknown Progress Handler type {typeof(T)}");
}
}));
}
private void PrepareLoadScreen()
{
using MemoryStream stream = new(SelectedIcon);
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
using var gameIconBmp = Image.Load<Bgra32>(stream);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
var dominantColor = IconColorPicker.GetFilteredColor(gameIconBmp).ToPixel<Bgra32>();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
const float ColorMultiple = 0.5f;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Color progressFgColor = Color.FromRgb(dominantColor.R, dominantColor.G, dominantColor.B);
Color progressBgColor = Color.FromRgb(
(byte)(dominantColor.R * ColorMultiple),
(byte)(dominantColor.G * ColorMultiple),
(byte)(dominantColor.B * ColorMultiple));
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ProgressBarForegroundColor = new SolidColorBrush(progressFgColor);
ProgressBarBackgroundColor = new SolidColorBrush(progressBgColor);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private void InitializeGame()
{
RendererHostControl.WindowCreated += RendererHost_Created;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
AppHost.StatusUpdatedEvent += Update_StatusBar;
AppHost.AppExit += AppHost_AppExit;
_rendererWaitEvent.WaitOne();
AppHost?.Start();
AppHost?.DisposeContext();
}
private async Task HandleRelaunch()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
if (UserChannelPersistence.PreviousIndex != -1 && UserChannelPersistence.ShouldRestart)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
UserChannelPersistence.ShouldRestart = false;
await LoadApplication(_currentEmulatedGamePath);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
}
else
{
// Otherwise, clear state.
UserChannelPersistence = new UserChannelPersistence();
_currentEmulatedGamePath = null;
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
private void Update_StatusBar(object sender, StatusUpdatedEventArgs args)
{
if (ShowMenuAndStatusBar && !ShowLoadProgress)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Dispatcher.UIThread.InvokeAsync(() =>
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
Application.Current.Styles.TryGetResource(args.VSyncEnabled
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
? "VsyncEnabled"
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
: "VsyncDisabled",
Application.Current.ActualThemeVariant,
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
out object color);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
if (color is not null)
{
VsyncColor = new SolidColorBrush((Color)color);
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
DockedStatusText = args.DockedMode;
AspectRatioStatusText = args.AspectRatio;
GameStatusText = args.GameStatus;
VolumeStatusText = args.VolumeStatus;
FifoStatusText = args.FifoStatus;
GpuNameText = args.GpuName;
BackendText = args.GpuBackend;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ShowStatusSeparator = true;
});
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}
private void RendererHost_Created(object sender, EventArgs e)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ShowLoading(false);
_rendererWaitEvent.Set();
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
#endregion
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
#region PublicMethods
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
public void SetUiProgressHandlers(Switch emulationContext)
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
if (emulationContext.Processes.ActiveApplication.DiskCacheLoadState != null)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
emulationContext.Processes.ActiveApplication.DiskCacheLoadState.StateChanged -= ProgressHandler;
emulationContext.Processes.ActiveApplication.DiskCacheLoadState.StateChanged += ProgressHandler;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
emulationContext.Gpu.ShaderCacheStateChanged -= ProgressHandler;
emulationContext.Gpu.ShaderCacheStateChanged += ProgressHandler;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
UI - Avalonia Part 2 (#3351) * add settings windows and children views * Expose hotkeys configuration on the UI * Remove double spacing from locale JSON * simplify button assigner * add cemuhook buttons and title to locale * move common button assigner to own class * cancel button assigner when window is closed * remove unused setting * address review. fix controller profile not loading default when switching devices * fix updater file name * Input cleanup (#37) * addressed review * add device type to controller device checks * change accessibility modifier of public classes to internal * Update Ryujinx.Ava/Ui/ViewModels/ControllerSettingsViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update de_DE.json * Update de_DE.json * Update tr_TR.json Translated newly added lines * Update it_IT.json * fix rebase * update avalonia * fix wrong key used for button text * Align settings window elements * Tabs to spaces * Update brazilian portuguese translation * Minor improvement on brazilian portuguese translation * fix turkish translation * remove unused text * change view related classes to public * unsubscribe from deferred event if dialog is closed * Load the default language before loading any other when switching languages * Make controller settings more compact * increase default width of settings window, reduce profile buttons width Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com>
2022-07-05 18:06:31 +00:00
public void LoadConfigurableHotKeys()
{
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
if (AvaloniaKeyboardMappingHelper.TryGetAvaKey((Key)ConfigurationState.Instance.Hid.Hotkeys.Value.ShowUi, out var showUiKey))
UI - Avalonia Part 2 (#3351) * add settings windows and children views * Expose hotkeys configuration on the UI * Remove double spacing from locale JSON * simplify button assigner * add cemuhook buttons and title to locale * move common button assigner to own class * cancel button assigner when window is closed * remove unused setting * address review. fix controller profile not loading default when switching devices * fix updater file name * Input cleanup (#37) * addressed review * add device type to controller device checks * change accessibility modifier of public classes to internal * Update Ryujinx.Ava/Ui/ViewModels/ControllerSettingsViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update de_DE.json * Update de_DE.json * Update tr_TR.json Translated newly added lines * Update it_IT.json * fix rebase * update avalonia * fix wrong key used for button text * Align settings window elements * Tabs to spaces * Update brazilian portuguese translation * Minor improvement on brazilian portuguese translation * fix turkish translation * remove unused text * change view related classes to public * unsubscribe from deferred event if dialog is closed * Load the default language before loading any other when switching languages * Make controller settings more compact * increase default width of settings window, reduce profile buttons width Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com>
2022-07-05 18:06:31 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ShowUiKey = new KeyGesture(showUiKey);
UI - Avalonia Part 2 (#3351) * add settings windows and children views * Expose hotkeys configuration on the UI * Remove double spacing from locale JSON * simplify button assigner * add cemuhook buttons and title to locale * move common button assigner to own class * cancel button assigner when window is closed * remove unused setting * address review. fix controller profile not loading default when switching devices * fix updater file name * Input cleanup (#37) * addressed review * add device type to controller device checks * change accessibility modifier of public classes to internal * Update Ryujinx.Ava/Ui/ViewModels/ControllerSettingsViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update de_DE.json * Update de_DE.json * Update tr_TR.json Translated newly added lines * Update it_IT.json * fix rebase * update avalonia * fix wrong key used for button text * Align settings window elements * Tabs to spaces * Update brazilian portuguese translation * Minor improvement on brazilian portuguese translation * fix turkish translation * remove unused text * change view related classes to public * unsubscribe from deferred event if dialog is closed * Load the default language before loading any other when switching languages * Make controller settings more compact * increase default width of settings window, reduce profile buttons width Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com>
2022-07-05 18:06:31 +00:00
}
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
if (AvaloniaKeyboardMappingHelper.TryGetAvaKey((Key)ConfigurationState.Instance.Hid.Hotkeys.Value.Screenshot, out var screenshotKey))
UI - Avalonia Part 2 (#3351) * add settings windows and children views * Expose hotkeys configuration on the UI * Remove double spacing from locale JSON * simplify button assigner * add cemuhook buttons and title to locale * move common button assigner to own class * cancel button assigner when window is closed * remove unused setting * address review. fix controller profile not loading default when switching devices * fix updater file name * Input cleanup (#37) * addressed review * add device type to controller device checks * change accessibility modifier of public classes to internal * Update Ryujinx.Ava/Ui/ViewModels/ControllerSettingsViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update de_DE.json * Update de_DE.json * Update tr_TR.json Translated newly added lines * Update it_IT.json * fix rebase * update avalonia * fix wrong key used for button text * Align settings window elements * Tabs to spaces * Update brazilian portuguese translation * Minor improvement on brazilian portuguese translation * fix turkish translation * remove unused text * change view related classes to public * unsubscribe from deferred event if dialog is closed * Load the default language before loading any other when switching languages * Make controller settings more compact * increase default width of settings window, reduce profile buttons width Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com>
2022-07-05 18:06:31 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ScreenshotKey = new KeyGesture(screenshotKey);
UI - Avalonia Part 2 (#3351) * add settings windows and children views * Expose hotkeys configuration on the UI * Remove double spacing from locale JSON * simplify button assigner * add cemuhook buttons and title to locale * move common button assigner to own class * cancel button assigner when window is closed * remove unused setting * address review. fix controller profile not loading default when switching devices * fix updater file name * Input cleanup (#37) * addressed review * add device type to controller device checks * change accessibility modifier of public classes to internal * Update Ryujinx.Ava/Ui/ViewModels/ControllerSettingsViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update de_DE.json * Update de_DE.json * Update tr_TR.json Translated newly added lines * Update it_IT.json * fix rebase * update avalonia * fix wrong key used for button text * Align settings window elements * Tabs to spaces * Update brazilian portuguese translation * Minor improvement on brazilian portuguese translation * fix turkish translation * remove unused text * change view related classes to public * unsubscribe from deferred event if dialog is closed * Load the default language before loading any other when switching languages * Make controller settings more compact * increase default width of settings window, reduce profile buttons width Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com>
2022-07-05 18:06:31 +00:00
}
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
if (AvaloniaKeyboardMappingHelper.TryGetAvaKey((Key)ConfigurationState.Instance.Hid.Hotkeys.Value.Pause, out var pauseKey))
UI - Avalonia Part 2 (#3351) * add settings windows and children views * Expose hotkeys configuration on the UI * Remove double spacing from locale JSON * simplify button assigner * add cemuhook buttons and title to locale * move common button assigner to own class * cancel button assigner when window is closed * remove unused setting * address review. fix controller profile not loading default when switching devices * fix updater file name * Input cleanup (#37) * addressed review * add device type to controller device checks * change accessibility modifier of public classes to internal * Update Ryujinx.Ava/Ui/ViewModels/ControllerSettingsViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update de_DE.json * Update de_DE.json * Update tr_TR.json Translated newly added lines * Update it_IT.json * fix rebase * update avalonia * fix wrong key used for button text * Align settings window elements * Tabs to spaces * Update brazilian portuguese translation * Minor improvement on brazilian portuguese translation * fix turkish translation * remove unused text * change view related classes to public * unsubscribe from deferred event if dialog is closed * Load the default language before loading any other when switching languages * Make controller settings more compact * increase default width of settings window, reduce profile buttons width Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com>
2022-07-05 18:06:31 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
PauseKey = new KeyGesture(pauseKey);
UI - Avalonia Part 2 (#3351) * add settings windows and children views * Expose hotkeys configuration on the UI * Remove double spacing from locale JSON * simplify button assigner * add cemuhook buttons and title to locale * move common button assigner to own class * cancel button assigner when window is closed * remove unused setting * address review. fix controller profile not loading default when switching devices * fix updater file name * Input cleanup (#37) * addressed review * add device type to controller device checks * change accessibility modifier of public classes to internal * Update Ryujinx.Ava/Ui/ViewModels/ControllerSettingsViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update de_DE.json * Update de_DE.json * Update tr_TR.json Translated newly added lines * Update it_IT.json * fix rebase * update avalonia * fix wrong key used for button text * Align settings window elements * Tabs to spaces * Update brazilian portuguese translation * Minor improvement on brazilian portuguese translation * fix turkish translation * remove unused text * change view related classes to public * unsubscribe from deferred event if dialog is closed * Load the default language before loading any other when switching languages * Make controller settings more compact * increase default width of settings window, reduce profile buttons width Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: MutantAura <44103205+MutantAura@users.noreply.github.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com>
2022-07-05 18:06:31 +00:00
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public void TakeScreenshot()
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
AppHost.ScreenshotRequested = true;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
public void HideUi()
{
ShowMenuAndStatusBar = false;
}
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
public void ToggleStartGamesInFullscreen()
{
StartGamesInFullscreen = !StartGamesInFullscreen;
}
public void ToggleShowConsole()
{
ShowConsole = !ShowConsole;
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public void SetListMode()
{
Glyph = Glyph.List;
}
public void SetGridMode()
{
Glyph = Glyph.Grid;
}
public void SetAspectRatio(AspectRatio aspectRatio)
{
ConfigurationState.Instance.Graphics.AspectRatio.Value = aspectRatio;
}
public async Task InstallFirmwareFromFile()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
var result = await StorageProvider.OpenFilePickerAsync(new FilePickerOpenOptions
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
AllowMultiple = false,
FileTypeFilter = new List<FilePickerFileType>
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
new(LocaleManager.Instance[LocaleKeys.FileDialogAllTypes])
{
Patterns = new[] { "*.xci", "*.zip" },
AppleUniformTypeIdentifiers = new[] { "com.ryujinx.xci", "public.zip-archive" },
MimeTypes = new[] { "application/x-nx-xci", "application/zip" },
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
},
new("XCI")
{
Patterns = new[] { "*.xci" },
AppleUniformTypeIdentifiers = new[] { "com.ryujinx.xci" },
MimeTypes = new[] { "application/x-nx-xci" },
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
},
new("ZIP")
{
Patterns = new[] { "*.zip" },
AppleUniformTypeIdentifiers = new[] { "public.zip-archive" },
MimeTypes = new[] { "application/zip" },
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
},
},
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
});
if (result.Count > 0)
{
await HandleFirmwareInstallation(result[0].Path.LocalPath);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public async Task InstallFirmwareFromFolder()
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
var result = await StorageProvider.OpenFolderPickerAsync(new FolderPickerOpenOptions
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
AllowMultiple = false,
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
});
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
if (result.Count > 0)
{
await HandleFirmwareInstallation(result[0].Path.LocalPath);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
public void OpenRyujinxFolder()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
OpenHelper.OpenFolder(AppDataManager.BaseDirPath);
}
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
public void OpenLogsFolder()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Include a start.sh file with correct launch options (#4013) * Include reference to start.sh to be bundled * Add start.sh * Fix silly mistake I made on windows-x64 * ... I cannot read properly * Make same changes for avalonia csproj * Remove notice from start.sh Co-authored-by: Mary-nyan <thog@protonmail.com> * Update Ryujinx/Ryujinx.csproj Co-authored-by: Mary-nyan <thog@protonmail.com> * Update Ryujinx.Ava/Ryujinx.Ava.csproj Co-authored-by: Mary-nyan <thog@protonmail.com> * Update distribution/linux/start.sh Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update distribution/linux/start.sh Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.Ava/Ryujinx.Ava.csproj Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Update Ryujinx.csproj * Update Ryujinx.Ava.csproj * Rename start.sh to Ryujinx.sh * Update Ryujinx.csproj * Update Ryujinx.Ava.csproj * Update Ryujinx.Ava.csproj * Update Ryujinx.Ava/Ryujinx.Ava.csproj Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com> * Add `GDK_BACKEND` variable * Update Ryujinx.Ava.csproj * Update Program.cs * Update Program.cs * Update Ryujinx.sh * Update Program.cs * linux: Register mime types on launch * Add DOTNET_EnableAlternateStackCheck=1 to desktop file * linux: Add exclusion for RegisterMimeTypes for flathub builds * Update logo path * Cleanup Ryujinx.sh * Fix typo in ReleaseInformation * gha: Fix permissions for linux release binaries * ava: Rename output assembly to Ryujinx * Update mime database after installing new types Wait until logging is available before registering mime types * Copy mime types to output directory Co-authored-by: Mary-nyan <thog@protonmail.com> Co-authored-by: TSRBerry <20988865+TSRBerry@users.noreply.github.com>
2023-01-07 08:06:13 +00:00
string logPath = Path.Combine(ReleaseInformation.GetBaseApplicationDirectory(), "Logs");
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
new DirectoryInfo(logPath).Create();
OpenHelper.OpenFolder(logPath);
}
public void ToggleDockMode()
{
if (IsGameRunning)
{
ConfigurationState.Instance.System.EnableDockedMode.Value = !ConfigurationState.Instance.System.EnableDockedMode.Value;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}
public async Task ExitCurrentState()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
if (WindowState == WindowState.FullScreen)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
ToggleFullscreen();
}
else if (IsGameRunning)
{
await Task.Delay(100);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
AppHost?.ShowExitPrompt();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
public static void ChangeLanguage(object languageCode)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
LocaleManager.Instance.LoadLanguage((string)languageCode);
if (Program.PreviewerDetached)
{
ConfigurationState.Instance.Ui.LanguageCode.Value = (string)languageCode;
ConfigurationState.Instance.ToFileFormat().SaveConfig(Program.ConfigurationPath);
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
public async Task ManageProfiles()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
await NavigationDialogHost.Show(AccountManager, ContentManager, VirtualFileSystem, LibHacHorizonManager.RyujinxClient);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
public void SimulateWakeUpMessage()
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
AppHost.Device.System.SimulateWakeUpMessage();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
public async Task OpenFile()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
var result = await StorageProvider.OpenFilePickerAsync(new FilePickerOpenOptions
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
Title = LocaleManager.Instance[LocaleKeys.OpenFileDialogTitle],
AllowMultiple = false,
FileTypeFilter = new List<FilePickerFileType>
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
new(LocaleManager.Instance[LocaleKeys.AllSupportedFormats])
{
Patterns = new[] { "*.nsp", "*.xci", "*.nca", "*.nro", "*.nso" },
AppleUniformTypeIdentifiers = new[]
{
"com.ryujinx.nsp",
"com.ryujinx.xci",
"com.ryujinx.nca",
"com.ryujinx.nro",
"com.ryujinx.nso",
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
},
MimeTypes = new[]
{
"application/x-nx-nsp",
"application/x-nx-xci",
"application/x-nx-nca",
"application/x-nx-nro",
"application/x-nx-nso",
},
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
},
new("NSP")
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
Patterns = new[] { "*.nsp" },
AppleUniformTypeIdentifiers = new[] { "com.ryujinx.nsp" },
MimeTypes = new[] { "application/x-nx-nsp" },
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
},
new("XCI")
{
Patterns = new[] { "*.xci" },
AppleUniformTypeIdentifiers = new[] { "com.ryujinx.xci" },
MimeTypes = new[] { "application/x-nx-xci" },
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
},
new("NCA")
{
Patterns = new[] { "*.nca" },
AppleUniformTypeIdentifiers = new[] { "com.ryujinx.nca" },
MimeTypes = new[] { "application/x-nx-nca" },
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
},
new("NRO")
{
Patterns = new[] { "*.nro" },
AppleUniformTypeIdentifiers = new[] { "com.ryujinx.nro" },
MimeTypes = new[] { "application/x-nx-nro" },
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
},
new("NSO")
{
Patterns = new[] { "*.nso" },
AppleUniformTypeIdentifiers = new[] { "com.ryujinx.nso" },
MimeTypes = new[] { "application/x-nx-nso" },
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
},
},
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
});
if (result.Count > 0)
{
await LoadApplication(result[0].Path.LocalPath);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public async Task OpenFolder()
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
var result = await StorageProvider.OpenFolderPickerAsync(new FolderPickerOpenOptions
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
Title = LocaleManager.Instance[LocaleKeys.OpenFolderDialogTitle],
AllowMultiple = false,
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
});
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Ava UI: Avalonia 11 & FluentAvalonia 2 Support (#4362) * It builds (Doesn’t run waiting on FluentAvalonia Preview 5 Release) * Enable CompiledBindings by default * Ignore `PointerPressedEventArgs` Init warning * Define MIME and UTI Types * Update `UserProfileImageSelectorView` to StorageProvider API * PFS0 Magic * Update `MainWindowViewModel` to StorageProvider API * Update `SettingsUIView` to StorageProvider API * Update `ApplicationHelper` to StorageProvider API * Use `IsCheckChanged` * Rename events * Update Fluent Avalonia to Preivew 5 * More package updates * Fix long selection bar * return glyph value directly, instead of using a binding * fix menu item checkboxes * Fix build * Update to Preview 6 Unicorn conflict Fix remaining package oopsie * Fix issues from merge * Fix some warnings * Warnings * Squashed commit of the following: commit 79d1c190dba48e405a833f654691e47509a29792 Author: Mary <mary@mary.zone> Date: Sun Apr 16 11:38:07 2023 +0200 chore: Update Silk.NET to 2.17.1 (#4686) commit 2bc88467eb377a0ca1a8b51700300422422c8c37 Author: Ac_K <Acoustik666@gmail.com> Date: Sun Apr 16 09:37:31 2023 +0000 Update README.md commit baf8752e74488a419074ae1d484e54a00bc01973 Author: Vincenzo Nizza <vincenzonizzaufficio@gmail.com> Date: Sun Apr 16 11:19:33 2023 +0200 Ensure the updater doesn't delete hidden or system files (#4626) * Copy desktop.ini to update directory if it exists in HomeDir * EnumerateFilesToDelete() exclude files with "Hidden" and "System" attributes commit d5e4378aea086d9219f890e33cf81d566d96b9ae Author: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Date: Sun Apr 16 09:02:06 2023 +0000 nuget: bump DynamicData from 7.13.1 to 7.13.5 (#4654) Bumps [DynamicData](https://github.com/reactiveui/DynamicData) from 7.13.1 to 7.13.5. - [Release notes](https://github.com/reactiveui/DynamicData/releases) - [Changelog](https://github.com/reactivemarbles/DynamicData/blob/main/ReleaseNotes.md) - [Commits](https://github.com/reactiveui/DynamicData/compare/7.13.1...7.13.5) --- updated-dependencies: - dependency-name: DynamicData dependency-type: direct:production update-type: version-update:semver-patch ... Signed-off-by: dependabot[bot] <support@github.com> Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> commit 6dbcdfea47e60aadefd59a75e43549793481f853 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Sun Apr 16 09:09:02 2023 +0200 Ava: Fix nca extraction window never closing & minor cleanup (#4569) * ava: Remove unused doWhileDeferred parameters * ava: Minimally improve swkbd dialog It's currently impossible to get the dialog to redirect focus to the InputBox. * ava: Fix nca extraction dialog never closing Also contains some minor cleanup commit c5258cf082b10f335f81487f22b7eeb86075e09e Author: NitroTears <73270647+NitroTears@users.noreply.github.com> Date: Sun Apr 16 11:03:35 2023 +1000 Ability to hide file types in Game List (#4555) * Added HiddenFileTypes to config state, and check to file enumeration * Added hiddenfiletypes checkboxes to the UI * Added Ava version of HiddenFileTypes * Inverted Hide to Show with file types, minor formatting * all variables with a reference to 'hidden' is now 'shown' * one more variable name changed * review feedback * added FileTypes extension methof to get the correlating config value * moved extension method to new folder and file in Ryujinx.Ui.Common * added default case for ToggleFileType * changed exception type to OutOfRangeException commit 5c89e22bb98072adc240c2eb2d26d25fa119fe7d Author: Daniel Shala <daniel.shala08@gmail.com> Date: Sat Apr 15 18:11:24 2023 +0200 Added check for eventual symlink when displaying game files. (#4526) * Added check for eventual symlink when displaying game files. * Moved symlink check logic * Moved symlink check logic * Fixed prev commit --------- Co-authored-by: Daniel Shala <danielshala00@gmail.com> commit 11ecff2ff04633d261b9a43db792f6438df63f40 Author: Alex Barney <thealexbarney@gmail.com> Date: Fri Apr 14 16:00:34 2023 -0700 Rename Hipc to Cmif where appropriate (#3880) commit 4c3f09644a033dbf70258c4c0e5a848263b16bbd Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Wed Apr 12 20:18:40 2023 +0100 Move swkbd message null check into constructor (#4671) commit e187a8870a6f19ac0a85b08aece3c1a1e196e379 Author: TSRBerry <20988865+TSRBerry@users.noreply.github.com> Date: Wed Apr 12 03:09:47 2023 +0200 HLE: Deal with empty title names properly (#4643) * hle: Deal with empty titleNames in some languages * gui: Fix displaying the wrong title name * Remove unnecessary bounds check * Fix a NRE when getting the version string * Restore empty string logic commit a64fee29dc6b8e523d61abb7e79ceaa95a558c6c Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 08:23:41 2023 +0100 Vulkan: add situational "Fast Flush" mode (#4667) * Flush in the middle of long command buffers. * Vulkan: add situational "Fast Flush" mode The AutoFlushCounter class was added to periodically flush Vulkan command buffers throughout a frame, which reduces latency to the GPU as commands are submitted and processed much sooner. This was done by allowing command buffers to flush when framebuffer attachments changed. However, some games have incredibly long render passes with a large number of draws, and really aggressive data access that forces GPU sync. The Vulkan backend could potentially end up building a single command buffer for 4-5ms if a pass has enough draws, such as in BOTW. In the scenario where sync is waited on immediately after submission, this would have to wait for the completion of a much longer command buffer than usual. The solution is to force command buffer submission periodically in a "fast flush" mode. This will end up splitting render passes, but it will only enable if sync is aggressive enough. This should improve performance in GPU limited scenarios, or in games that aggressively wait on synchronization. In some games, it may only kick in when res scaling. It won't trigger in games like SMO where sync is not an issue. Improves performance in Pokemon Scarlet/Violet (res scaled) and BOTW (in general). * Add conversions in milliseconds next to flush timers. commit 9ef94c8292beda825fa76e05ad2e561c6d571c95 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:55:04 2023 +0100 ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext (#4661) * ARMeilleure: Move TPIDR_EL0 and TPIDRRO_EL0 to NativeContext Some games access these system registers several tens of thousands of times in a second from many different threads. While this isn't really crippling, it is a lot of wasted time spent in a reverse pinvoke transition. Example games are Pokemon Scarlet/Violet and BOTW. These games have a lot of different potential bottlenecks so it's unlikely you will see a consistent improvement, but it definitely disappears from the cpu profile. * Remove unreachable code. * Add ulong conversion for offsets * Nit commit 915d6d044cbf8c89935f14b8c7e085ad729f0e28 Author: riperiperi <rhy3756547@hotmail.com> Date: Tue Apr 11 07:32:31 2023 +0100 OpenGL: Fix OBS/Overlays again by binding FB before present (#4668) This seems to have been removed by the Post-Processing PR, but it is required for the display in OBS to be the right way up and properly scaled. I've tested this with AA and FSR on MK8D and it seems to behave properly. Testing is welcome. commit a4780ab33b9ca6b698917ded3ef6db6e6716cad1 Author: MutantAura <44103205+MutantAura@users.noreply.github.com> Date: Mon Apr 10 23:04:31 2023 +0100 Force activate parent window before dialog is shown (#4663) * Fix build Extraction dialogue not working * Avalonia Preview 7 Needs Fluent Avalonia update still… * Fix Render Scaling * Update Fluent Avalonia * Remove `pfs0` as runnable file type * Restore Info.plist formatting * Plist Format * Update Avalonia.Svg.Skia * Update theme code (TODO) * swtich to using theme variants for light dark * Fix crashes * Text centering issues * Update `TitleUpdateViewModel` to StorageProvider API * Fixed for new PR (Will crash on launch) * Fixes… * UI: Fix sections extraction (#4820) * UI: Fix sections extraction There is currently an issue when the update NCA doesn't contains the section we want to extract, this is fixed by adding a check. I have fixed the inverted handler of ExeFs/Logo introduced in #4755. Fixes #4521 * Addresses feedback * Fix issues… * Preview 8 * Fix fuck ups * Fixes * More cleanup * Ava 11 RC Maybe there is a god * Update FluentAvalonia * update svg * Second RC (kill me) * It builds * Ava 11 * Remove unnecessary usings * Fix build * Formatting * GAS GAS GAS!!!! * Fix DLC Window Crash * Linux runner try not to crash challenge (impossible) * Add app.manifest * Fix accidental Silk.NET.Vulkan bump * Try fix truncation * Linux fix popup Windows * Fix cutoff text on windows * Status bar styling fixes * Volume Toggle Split Button Fixes * Fix load bar color * Fix shortcuts * Best we're gonna get * Fix spacing Co-authored-by: Exhigh <exhigh01@gmail.com> * Formatting * Fix Profile Dropdown * Fix Window Startup Position * Format Fixes * Fix stupid mistake * Fix accidental change * Scaling Handler (peri pls make sure is working) * Remove Locale Reflection Binding Use + Unsued Usings * Fix formatting Code styling Ughhhh Fix interface Make TimeZoneConverter internal * Remove bell workaround (no longer needed) * Disable accent menu * Update to Ava 11.0.2 * Peri suggestions * Formatting * Cleanup a bunch of jank * Dependency update * Berry fixes and suggestions * Final suggestions * Rename assemblyIdentity to Ryujinx.Emulator.Avalonia --------- Co-authored-by: Emmanuel Hansen <emmausssss@gmail.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: Exhigh <exhigh01@gmail.com> Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com>
2023-08-12 00:47:22 +00:00
if (result.Count > 0)
{
await LoadApplication(result[0].Path.LocalPath);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
}
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
public async Task LoadApplication(string path, bool startFullscreen = false, string titleName = "")
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
if (AppHost != null)
{
await ContentDialogHelper.CreateInfoDialog(
LocaleManager.Instance[LocaleKeys.DialogLoadAppGameAlreadyLoadedMessage],
LocaleManager.Instance[LocaleKeys.DialogLoadAppGameAlreadyLoadedSubMessage],
LocaleManager.Instance[LocaleKeys.InputDialogOk],
"",
LocaleManager.Instance[LocaleKeys.RyujinxInfo]);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
return;
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
#if RELEASE
await PerformanceCheck();
#endif
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
Logger.RestartTime();
Add "Create Shortcut" To app context menu (#4734) * Added basic implementation for shortcut creation Currently bitmaps (.bmp) are used as the source file, colours are good (unlike .ico rn) but are scaled poorly on desktop. * Icons display properly in shortcut * code cleanup * Moved shortcut logic to specific file, added Ava UI for shortcuts * Added linux .desktop shortcut creation * fixes to .shortcut data * code issue fixes * Added basic implementation for shortcut creation Currently bitmaps (.bmp) are used as the source file, colours are good (unlike .ico rn) but are scaled poorly on desktop. * Icons display properly in shortcut * code cleanup * Moved shortcut logic to specific file, added Ava UI for shortcuts * Added linux .desktop shortcut creation * fixes to .shortcut data * code issue fixes * added back shortcut to new contextmenu file * Replaced COM reference with ComImport for shortcut functionality * remove specific platform values and regions * Move ShortcutHelper to Ryujinx.Ui.Common.Helpers * Adjust styling and structure * code feedback changes * Added MacOS support using .app folder * Added basic implementation for shortcut creation Currently bitmaps (.bmp) are used as the source file, colours are good (unlike .ico rn) but are scaled poorly on desktop. * Icons display properly in shortcut * code cleanup * Moved shortcut logic to specific file, added Ava UI for shortcuts * Added linux .desktop shortcut creation * fixes to .shortcut data * code issue fixes * Added basic implementation for shortcut creation Currently bitmaps (.bmp) are used as the source file, colours are good (unlike .ico rn) but are scaled poorly on desktop. * Icons display properly in shortcut * code cleanup * Moved shortcut logic to specific file, added Ava UI for shortcuts * Added linux .desktop shortcut creation * fixes to .shortcut data * code issue fixes * Replaced COM reference with ComImport for shortcut functionality * remove specific platform values and regions * Move ShortcutHelper to Ryujinx.Ui.Common.Helpers * Adjust styling and structure * code feedback changes * adjust tooltip message * added shortcut-template.desktop file * set shortcut icon location to .local/share/icons * Linux code feedback changes * change InteropServices to new securifybv.ShellLink Package * added ShellLink to readme, updated shortcut comment * Code feedback changes * Added MacOS Support (As per Jose Estrada's PR) * dotnet format * Small restructuring * Embed template files into Ryujinx.Ui.Common * Disable "CreateShortcut" option for flatpak builds --------- Co-authored-by: TSR Berry <20988865+TSRBerry@users.noreply.github.com> Co-authored-by: Jose Estrada <joseestradacobo@gmail.com>
2023-10-20 18:51:15 +00:00
SelectedIcon ??= ApplicationLibrary.GetApplicationIcon(path, ConfigurationState.Instance.System.Language);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
PrepareLoadScreen();
RendererHostControl = new RendererHost();
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
AppHost = new AppHost(
RendererHostControl,
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
InputManager,
path,
VirtualFileSystem,
ContentManager,
AccountManager,
UserChannelPersistence,
this,
TopLevel);
if (!await AppHost.LoadGuestApplication())
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
AppHost.DisposeContext();
AppHost = null;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
return;
}
CanUpdate = false;
LoadHeading = TitleName = titleName;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
if (string.IsNullOrWhiteSpace(titleName))
{
LoadHeading = LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.LoadingHeading, AppHost.Device.Processes.ActiveApplication.Name);
TitleName = AppHost.Device.Processes.ActiveApplication.Name;
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
SwitchToRenderer(startFullscreen);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
_currentEmulatedGamePath = path;
Thread gameThread = new(InitializeGame) { Name = "GUI.WindowThread" };
gameThread.Start();
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public void SwitchToRenderer(bool startFullscreen)
{
Dispatcher.UIThread.Post(() =>
{
SwitchToGameControl(startFullscreen);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
SetMainContent(RendererHostControl);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
RendererHostControl.Focus();
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
});
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
public static void UpdateGameMetadata(string titleId)
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
ApplicationLibrary.LoadAndSaveMetaData(titleId, appMetadata =>
{
if (appMetadata.LastPlayed.HasValue)
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
double sessionTimePlayed = DateTime.UtcNow.Subtract(appMetadata.LastPlayed.Value).TotalSeconds;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
appMetadata.TimePlayed += Math.Round(sessionTimePlayed, MidpointRounding.AwayFromZero);
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
appMetadata.LastPlayed = DateTime.UtcNow;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
});
}
public void RefreshFirmwareStatus()
{
SystemVersion version = null;
try
{
version = ContentManager.GetCurrentFirmwareVersion();
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
catch (Exception) { }
bool hasApplet = false;
if (version != null)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.StatusBarSystemVersion, version.VersionString);
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
hasApplet = version.Major > 3;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
else
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
LocaleManager.Instance.UpdateAndGetDynamicValue(LocaleKeys.StatusBarSystemVersion, "0.0");
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
IsAppletMenuActive = hasApplet;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public void AppHost_AppExit(object sender, EventArgs e)
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
if (IsClosing)
{
return;
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
IsGameRunning = false;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Dispatcher.UIThread.InvokeAsync(async () =>
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ShowMenuAndStatusBar = true;
ShowContent = true;
ShowLoadProgress = false;
IsLoadingIndeterminate = false;
CanUpdate = true;
Cursor = Cursor.Default;
SetMainContent(null);
AppHost = null;
await HandleRelaunch();
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
});
RendererHostControl.WindowCreated -= RendererHost_Created;
RendererHostControl = null;
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
SelectedIcon = null;
Dispatcher.UIThread.InvokeAsync(() =>
{
Title = $"Ryujinx {Program.Version}";
});
}
public void ToggleFullscreen()
{
if (Environment.TickCount64 - LastFullscreenToggle < HotKeyPressDelayMs)
{
return;
}
LastFullscreenToggle = Environment.TickCount64;
if (WindowState == WindowState.FullScreen)
{
WindowState = WindowState.Normal;
if (IsGameRunning)
{
ShowMenuAndStatusBar = true;
}
}
else
{
WindowState = WindowState.FullScreen;
if (IsGameRunning)
{
ShowMenuAndStatusBar = false;
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
IsFullScreen = WindowState == WindowState.FullScreen;
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public static void SaveConfig()
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
ConfigurationState.Instance.ToFileFormat().SaveConfig(Program.ConfigurationPath);
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
public static async Task PerformanceCheck()
{
if (ConfigurationState.Instance.Logger.EnableTrace.Value)
{
string mainMessage = LocaleManager.Instance[LocaleKeys.DialogPerformanceCheckLoggingEnabledMessage];
string secondaryMessage = LocaleManager.Instance[LocaleKeys.DialogPerformanceCheckLoggingEnabledConfirmMessage];
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
UserResult result = await ContentDialogHelper.CreateConfirmationDialog(
mainMessage,
secondaryMessage,
LocaleManager.Instance[LocaleKeys.InputDialogYes],
LocaleManager.Instance[LocaleKeys.InputDialogNo],
LocaleManager.Instance[LocaleKeys.RyujinxConfirm]);
if (result == UserResult.Yes)
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
ConfigurationState.Instance.Logger.EnableTrace.Value = false;
SaveConfig();
}
}
if (!string.IsNullOrWhiteSpace(ConfigurationState.Instance.Graphics.ShadersDumpPath.Value))
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
{
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
string mainMessage = LocaleManager.Instance[LocaleKeys.DialogPerformanceCheckShaderDumpEnabledMessage];
string secondaryMessage = LocaleManager.Instance[LocaleKeys.DialogPerformanceCheckShaderDumpEnabledConfirmMessage];
UserResult result = await ContentDialogHelper.CreateConfirmationDialog(
mainMessage,
secondaryMessage,
LocaleManager.Instance[LocaleKeys.InputDialogYes],
LocaleManager.Instance[LocaleKeys.InputDialogNo],
LocaleManager.Instance[LocaleKeys.RyujinxConfirm]);
if (result == UserResult.Yes)
Ava GUI: `MainWindow` Refactor (#4178) * Fix redundancies * Add back elses * `MainWindow` Refactor * Switch commands to `ReflectionBinding` Not required in Ava 11 * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/AppHost.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainMenuBarView.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Update Ryujinx.Ava/UI/Views/Main/MainViewControls.axaml.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Resolve issues * Remove Ava 11 Fix * Update Ryujinx.Ava/UI/ViewModels/MainWindowViewModel.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Update Ryujinx.Ava/UI/Windows/MainWindow.axaml.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * Fix whitespace + other suggestions * Move Vsync colours to `Styles.xaml` * Remove catch all * Use `switch` instead of `if` * Update locale keys * Use block-scoped namespaces * Fix improper Ava api usage then * Static PTC * Fix `GridItemSelectorSize` with `ShowNames` * Update for new About Window * Add back search fix Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: gdkchan <gab.dark.100@gmail.com>
2023-01-08 17:46:25 +00:00
{
ConfigurationState.Instance.Graphics.ShadersDumpPath.Value = "";
SaveConfig();
}
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}
[Ryujinx.Ava] Address dotnet-format issues (#5361) * dotnet format style --severity info Some changes were manually reverted. * dotnet format analyzers --serverity info Some changes have been minimally adapted. * Restore a few unused methods and variables * Silence dotnet format IDE0060 warnings * Silence dotnet format IDE0052 warnings * Silence dotnet format IDE0059 warnings * Address or silence dotnet format IDE1006 warnings * Address dotnet format CA1816 warnings * Address dotnet format CA1822 warnings * Address or silence dotnet format CA1069 warnings * Make dotnet format succeed in style mode * Address dotnet format CA1401 warnings * Address remaining dotnet format analyzer warnings * Address review comments * dotnet-format fixes after rebase * Address most dotnet format whitespace warnings * Apply dotnet format whitespace formatting A few of them have been manually reverted and the corresponding warning was silenced * Format if-blocks correctly * Another rebase, another dotnet format run * Run dotnet format whitespace after rebase * Run dotnet format style after rebase * Run dotnet format after rebase and remove unused usings - analyzers - style - whitespace * Add comments to disabled warnings * Remove a few unused parameters * Simplify properties and array initialization, Use const when possible, Remove trailing commas * Start working on disabled warnings * Fix and silence a few dotnet-format warnings again * Address IDE0260 warnings * Address a few disabled IDE0060 warnings * Silence IDE0060 in .editorconfig * Revert "Simplify properties and array initialization, Use const when possible, Remove trailing commas" This reverts commit 9462e4136c0a2100dc28b20cf9542e06790aa67e. * dotnet format whitespace after rebase * dotnet format pass with new editorconfig * Fix naming style issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert one suggestion * Second dotnet format pass and fix build issues * Final pass of dotnet format * Add trailing commas * Fix formatting issues * Keep unnecessary assignment in IconColorPicker.cs * Use using declarations and extend resource lifetimes * Fix rebase issues * Adjust comment spacing * Fix typo * Fix naming issues * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Revert unintentional change * Remove unused file * Remove static keyword from ViewModels Binding of static members doesn't work and is silently ignored. --------- Co-authored-by: Ac_K <Acoustik666@gmail.com>
2023-07-07 21:03:27 +00:00
#endregion
Avalonia UI - Part 1 (#3270) * avalonia part 1 * remove vulkan ui backend * move ui common files to ui common project * get name for oading screen from device * rebase. * review 1 * review 1.1 * review * cleanup * addressed review * use cancellation token * review * review * rebased * cancel library loading when closing window * remove star image, use fonticon instead * delete render control frame buffer when game ends. change position of fav star * addressed @Thog review * ensure the right ui is downloaded in updates * fix crash when showing not supported dialog during controller request * add prefix to artifact names * Auto-format Avalonia project * Fix input * Fix build, simplify app disposal * remove nv stutter thread * addressed review * add missing change * maintain window size if new size is zero length * add game, handheld, docked to local * reverse scale main window * Update de_DE.json * Update de_DE.json * Update de_DE.json * Update italian json * Update it_IT.json * let render timer poll with no wait * remove unused code * more unused code * enabled tiered compilation and trimming * check if window event is not closed before signaling * fix atmospher case * locale fix * locale fix * remove explicit tiered compilation declarations * Remove ) it_IT.json * Remove ) de_DE.json * Update it_IT.json * Update pt_BR locale with latest strings * Remove ')' * add more strings to locale * update locale * remove extra slash * remove extra slash * set firmware version to 0 if key's not found * fix * revert timer changes * lock on object instead * Update it_IT.json * remove unused method * add load screen text to locale * drop swap event * Update de_DE.json * Update de_DE.json * do null check when stopping emulator * Update de_DE.json * Create tr_TR.json * Add tr_TR * Add tr_TR + Turkish * Update it_IT.json * Update Ryujinx.Ava/Input/AvaloniaMappingHelper.cs Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * Apply suggestions from code review Co-authored-by: Ac_K <Acoustik666@gmail.com> * addressed review * Update Ryujinx.Ava/Ui/Backend/OpenGl/OpenGlRenderTarget.cs Co-authored-by: gdkchan <gab.dark.100@gmail.com> * use avalonia's inbuilt renderer on linux * removed whitespace * workaround for queue render crash with vsync off * drop custom backend * format files * fix not closing issue * remove warnings * rebase * update avalonia library * Reposition the Text and Button on About Page * Assign build version * Remove appveyor text Co-authored-by: gdk <gab.dark.100@gmail.com> Co-authored-by: Niwu34 <67392333+Niwu34@users.noreply.github.com> Co-authored-by: Antonio Brugnolo <36473846+AntoSkate@users.noreply.github.com> Co-authored-by: aegiff <99728970+aegiff@users.noreply.github.com> Co-authored-by: Ac_K <Acoustik666@gmail.com> Co-authored-by: MostlyWhat <78652091+MostlyWhat@users.noreply.github.com>
2022-05-15 11:30:15 +00:00
}
}